About 2-chloro-6-[3-[(1S,2S)-2-(trifluoromethyl)cyclopropyl]oxypyrazol-1-yl]pyridine-3-carboxylic acid
2-chloro-6-[3-[(1S,2S)-2-(trifluoromethyl)cyclopropyl]oxypyrazol-1-yl]pyridine-3-carboxylic acid (PubChem CID 134393544) has the molecular formula C13H9ClF3N3O3
and a molecular weight of 347.68 g/mol. Its IUPAC name is 2-chloro-6-[3-[(1S,2S)-2-(trifluoromethyl)cyclopropyl]oxypyrazol-1-yl]pyridine-3-carboxylic acid.
Molecular Properties
| Compound Name | 2-chloro-6-[3-[(1S,2S)-2-(trifluoromethyl)cyclopropyl]oxypyrazol-1-yl]pyridine-3-carboxylic acid |
| PubChem CID | 134393544 |
| Molecular Formula | C13H9ClF3N3O3 |
| Molecular Weight | 347.68 g/mol |
| Exact Mass | 347.03 |
| IUPAC Name | 2-chloro-6-[3-[(1S,2S)-2-(trifluoromethyl)cyclopropyl]oxypyrazol-1-yl]pyridine-3-carboxylic acid |
| SMILES | O=C(O)c1ccc(-n2ccc(O[C@H]3C[C@@H]3C(F)(F)F)n2)nc1Cl |
| InChI | InChI=1S/C13H9ClF3N3O3/c14-11-6(12(21)22)1-2-9(18-11)20-4-3-10(19-20)23-8-5-7(8)13(15,16)17/h1-4,7-8H,5H2,(H,21,22)/t7-,8-/m0/s1 |
| InChIKey | ZXPNZTJAXHBHHJ-YUMQZZPRSA-N |
| XLogP | 2.95 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 347.68 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-6-[3-[(1S,2S)-2-(trifluoromethyl)cyclopropyl]oxypyrazol-1-yl]pyridine-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-6-[3-[(1S,2S)-2-(trifluoromethyl)cyclopropyl]oxypyrazol-1-yl]pyridine-3-carboxylic acid?
The IUPAC name of 2-chloro-6-[3-[(1S,2S)-2-(trifluoromethyl)cyclopropyl]oxypyrazol-1-yl]pyridine-3-carboxylic acid (CID 134393544) is 2-chloro-6-[3-[(1S,2S)-2-(trifluoromethyl)cyclopropyl]oxypyrazol-1-yl]pyridine-3-carboxylic acid.
What is the SMILES notation for 2-chloro-6-[3-[(1S,2S)-2-(trifluoromethyl)cyclopropyl]oxypyrazol-1-yl]pyridine-3-carboxylic acid?
The canonical SMILES for 2-chloro-6-[3-[(1S,2S)-2-(trifluoromethyl)cyclopropyl]oxypyrazol-1-yl]pyridine-3-carboxylic acid is O=C(O)c1ccc(-n2ccc(O[C@H]3C[C@@H]3C(F)(F)F)n2)nc1Cl.
What is the InChIKey of 2-chloro-6-[3-[(1S,2S)-2-(trifluoromethyl)cyclopropyl]oxypyrazol-1-yl]pyridine-3-carboxylic acid?
The InChIKey is ZXPNZTJAXHBHHJ-YUMQZZPRSA-N. The full InChI is InChI=1S/C13H9ClF3N3O3/c14-11-6(12(21)22)1-2-9(18-11)20-4-3-10(19-20)23-8-5-7(8)13(15,16)17/h1-4,7-8H,5H2,(H,21,22)/t7-,8-/m0/s1.
What are the key properties of 2-chloro-6-[3-[(1S,2S)-2-(trifluoromethyl)cyclopropyl]oxypyrazol-1-yl]pyridine-3-carboxylic acid?
2-chloro-6-[3-[(1S,2S)-2-(trifluoromethyl)cyclopropyl]oxypyrazol-1-yl]pyridine-3-carboxylic acid has a molecular weight of 347.68 g/mol, XLogP of 2.95, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-6-[3-[(1S,2S)-2-(trifluoromethyl)cyclopropyl]oxypyrazol-1-yl]pyridine-3-carboxylic acid is sourced from PubChem (CID 134393544), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).