C37H52N4O2S — CID 134393823
(5Z)-5-[[2-[bis(2-ethylhexyl)amino]-4-tert-butyl-1,3-thiazol-5-yl]methylidene]-4-methyl-2,6-dioxo-1-phenylpyridine-3-carbonitrile (PubChem CID 134393823) has the molecular formula C37H52N4O2S and a molecular weight of 616.92 g/mol. Its IUPAC name is (5Z)-5-[[2-[bis(2-ethylhexyl)amino]-4-tert-butyl-1,3-thiazol-5-yl]methylidene]-4-methyl-2,6-dioxo-1-phenylpyridine-3-carbonitrile.
| Compound Name | (5Z)-5-[[2-[bis(2-ethylhexyl)amino]-4-tert-butyl-1,3-thiazol-5-yl]methylidene]-4-methyl-2,6-dioxo-1-phenylpyridine-3-carbonitrile |
|---|---|
| PubChem CID | 134393823 |
| Molecular Formula | C37H52N4O2S |
| Molecular Weight | 616.92 g/mol |
| Exact Mass | 616.38 |
| IUPAC Name | (5Z)-5-[[2-[bis(2-ethylhexyl)amino]-4-tert-butyl-1,3-thiazol-5-yl]methylidene]-4-methyl-2,6-dioxo-1-phenylpyridine-3-carbonitrile |
| SMILES | CCCCC(CC)CN(CC(CC)CCCC)c1nc(C(C)(C)C)c(/C=C2\C(=O)N(c3ccccc3)C(=O)C(C#N)=C2C)s1 |
| InChI | InChI=1S/C37H52N4O2S/c1-9-13-18-27(11-3)24-40(25-28(12-4)19-14-10-2)36-39-33(37(6,7)8)32(44-36)22-30-26(5)31(23-38)35(43)41(34(30)42)29-20-16-15-17-21-29/h15-17,20-22,27-28H,9-14,18-19,24-25H2,1-8H3/b30-22- |
| InChIKey | BJDNDWNOBGBLMN-SWKFRHMKSA-N |
| XLogP | 9.48 |
| TPSA | 77.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.92 |
| LogP ≤ 5 | 9.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_C(11)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|