C27H27F2N3O4 — CID 134394343
2-[(2,6-difluorobenzoyl)amino]-3-[4-[3-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)propoxy]phenyl]propanoic acid (PubChem CID 134394343) has the molecular formula C27H27F2N3O4 and a molecular weight of 495.53 g/mol. Its IUPAC name is 2-[(2,6-difluorobenzoyl)amino]-3-[4-[3-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)propoxy]phenyl]propanoic acid.
| Compound Name | 2-[(2,6-difluorobenzoyl)amino]-3-[4-[3-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)propoxy]phenyl]propanoic acid |
|---|---|
| PubChem CID | 134394343 |
| Molecular Formula | C27H27F2N3O4 |
| Molecular Weight | 495.53 g/mol |
| Exact Mass | 495.20 |
| IUPAC Name | 2-[(2,6-difluorobenzoyl)amino]-3-[4-[3-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)propoxy]phenyl]propanoic acid |
| SMILES | O=C(NC(Cc1ccc(OCCCc2ccc3c(n2)NCCC3)cc1)C(=O)O)c1c(F)cccc1F |
| InChI | InChI=1S/C27H27F2N3O4/c28-21-6-1-7-22(29)24(21)26(33)32-23(27(34)35)16-17-8-12-20(13-9-17)36-15-3-5-19-11-10-18-4-2-14-30-25(18)31-19/h1,6-13,23H,2-5,14-16H2,(H,30,31)(H,32,33)(H,34,35) |
| InChIKey | MNVGBFDRFYHSKS-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 100.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.53 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|