C30H44N4O5 — CID 134394448
N-(2,2-dimethoxyethyl)-N-methyl-3-[2-[3-[(4-pyridin-2-yl-1-oxa-4,9-diazaspiro[5.5]undecan-9-yl)methyl]phenyl]ethoxy]propanamide (PubChem CID 134394448) has the molecular formula C30H44N4O5 and a molecular weight of 540.71 g/mol. Its IUPAC name is N-(2,2-dimethoxyethyl)-N-methyl-3-[2-[3-[(4-pyridin-2-yl-1-oxa-4,9-diazaspiro[5.5]undecan-9-yl)methyl]phenyl]ethoxy]propanamide.
| Compound Name | N-(2,2-dimethoxyethyl)-N-methyl-3-[2-[3-[(4-pyridin-2-yl-1-oxa-4,9-diazaspiro[5.5]undecan-9-yl)methyl]phenyl]ethoxy]propanamide |
|---|---|
| PubChem CID | 134394448 |
| Molecular Formula | C30H44N4O5 |
| Molecular Weight | 540.71 g/mol |
| Exact Mass | 540.33 |
| IUPAC Name | N-(2,2-dimethoxyethyl)-N-methyl-3-[2-[3-[(4-pyridin-2-yl-1-oxa-4,9-diazaspiro[5.5]undecan-9-yl)methyl]phenyl]ethoxy]propanamide |
| SMILES | COC(CN(C)C(=O)CCOCCc1cccc(CN2CCC3(CC2)CN(c2ccccn2)CCO3)c1)OC |
| InChI | InChI=1S/C30H44N4O5/c1-32(23-29(36-2)37-3)28(35)11-19-38-18-10-25-7-6-8-26(21-25)22-33-15-12-30(13-16-33)24-34(17-20-39-30)27-9-4-5-14-31-27/h4-9,14,21,29H,10-13,15-20,22-24H2,1-3H3 |
| InChIKey | ZVHPLBXQOJUQSI-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 76.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.71 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|