C31H46N4O6 — CID 134394547
N-(2,2-dimethoxyethyl)-N-methyl-3-[2-[3-[2-[4-(2-oxo-1H-pyridin-3-yl)-1-oxa-4,9-diazaspiro[5.5]undecan-9-yl]ethyl]phenyl]ethoxy]propanamide (PubChem CID 134394547) has the molecular formula C31H46N4O6 and a molecular weight of 570.73 g/mol. Its IUPAC name is N-(2,2-dimethoxyethyl)-N-methyl-3-[2-[3-[2-[4-(2-oxo-1H-pyridin-3-yl)-1-oxa-4,9-diazaspiro[5.5]undecan-9-yl]ethyl]phenyl]ethoxy]propanamide.
| Compound Name | N-(2,2-dimethoxyethyl)-N-methyl-3-[2-[3-[2-[4-(2-oxo-1H-pyridin-3-yl)-1-oxa-4,9-diazaspiro[5.5]undecan-9-yl]ethyl]phenyl]ethoxy]propanamide |
|---|---|
| PubChem CID | 134394547 |
| Molecular Formula | C31H46N4O6 |
| Molecular Weight | 570.73 g/mol |
| Exact Mass | 570.34 |
| IUPAC Name | N-(2,2-dimethoxyethyl)-N-methyl-3-[2-[3-[2-[4-(2-oxo-1H-pyridin-3-yl)-1-oxa-4,9-diazaspiro[5.5]undecan-9-yl]ethyl]phenyl]ethoxy]propanamide |
| SMILES | COC(CN(C)C(=O)CCOCCc1cccc(CCN2CCC3(CC2)CN(c2ccc[nH]c2=O)CCO3)c1)OC |
| InChI | InChI=1S/C31H46N4O6/c1-33(23-29(38-2)39-3)28(36)11-20-40-19-10-26-7-4-6-25(22-26)9-15-34-16-12-31(13-17-34)24-35(18-21-41-31)27-8-5-14-32-30(27)37/h4-8,14,22,29H,9-13,15-21,23-24H2,1-3H3,(H,32,37) |
| InChIKey | MOXQNNGCFFUJOP-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 96.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.73 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|