C25H33N3O4 — CID 134394591
2-[(3-methoxybenzoyl)amino]-9-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)nonanoic acid (PubChem CID 134394591) has the molecular formula C25H33N3O4 and a molecular weight of 439.56 g/mol. Its IUPAC name is 2-[(3-methoxybenzoyl)amino]-9-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)nonanoic acid.
| Compound Name | 2-[(3-methoxybenzoyl)amino]-9-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)nonanoic acid |
|---|---|
| PubChem CID | 134394591 |
| Molecular Formula | C25H33N3O4 |
| Molecular Weight | 439.56 g/mol |
| Exact Mass | 439.25 |
| IUPAC Name | 2-[(3-methoxybenzoyl)amino]-9-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)nonanoic acid |
| SMILES | COc1cccc(C(=O)NC(CCCCCCCc2ccc3c(n2)NCCC3)C(=O)O)c1 |
| InChI | InChI=1S/C25H33N3O4/c1-32-21-12-7-9-19(17-21)24(29)28-22(25(30)31)13-6-4-2-3-5-11-20-15-14-18-10-8-16-26-23(18)27-20/h7,9,12,14-15,17,22H,2-6,8,10-11,13,16H2,1H3,(H,26,27)(H,28,29)(H,30,31) |
| InChIKey | HMUBAPMUIJSSGX-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 100.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.56 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|