C33H42FN5O4S — CID 134394594
S-[6-[2-[2-[2-fluoro-5-[[4-(4-methyl-2-pyridinyl)-1-oxa-4,9-diazaspiro[5.5]undecan-9-yl]methyl]phenyl]ethylamino]-1-hydroxyethyl]-3-hydroxy-2-(methylamino)phenyl] methanethioate (PubChem CID 134394594) has the molecular formula C33H42FN5O4S and a molecular weight of 623.80 g/mol. Its IUPAC name is S-[6-[2-[2-[2-fluoro-5-[[4-(4-methyl-2-pyridinyl)-1-oxa-4,9-diazaspiro[5.5]undecan-9-yl]methyl]phenyl]ethylamino]-1-hydroxyethyl]-3-hydroxy-2-(methylamino)phenyl] methanethioate.
| Compound Name | S-[6-[2-[2-[2-fluoro-5-[[4-(4-methyl-2-pyridinyl)-1-oxa-4,9-diazaspiro[5.5]undecan-9-yl]methyl]phenyl]ethylamino]-1-hydroxyethyl]-3-hydroxy-2-(methylamino)phenyl] methanethioate |
|---|---|
| PubChem CID | 134394594 |
| Molecular Formula | C33H42FN5O4S |
| Molecular Weight | 623.80 g/mol |
| Exact Mass | 623.29 |
| IUPAC Name | S-[6-[2-[2-[2-fluoro-5-[[4-(4-methyl-2-pyridinyl)-1-oxa-4,9-diazaspiro[5.5]undecan-9-yl]methyl]phenyl]ethylamino]-1-hydroxyethyl]-3-hydroxy-2-(methylamino)phenyl] methanethioate |
| SMILES | CNc1c(O)ccc(C(O)CNCCc2cc(CN3CCC4(CC3)CN(c3cc(C)ccn3)CCO4)ccc2F)c1SC=O |
| InChI | InChI=1S/C33H42FN5O4S/c1-23-7-12-37-30(17-23)39-15-16-43-33(21-39)9-13-38(14-10-33)20-24-3-5-27(34)25(18-24)8-11-36-19-29(42)26-4-6-28(41)31(35-2)32(26)44-22-40/h3-7,12,17-18,22,29,35-36,41-42H,8-11,13-16,19-21H2,1-2H3 |
| InChIKey | QSDWVQXQZCRABC-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 110.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.80 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|