C33H50N4O5 — CID 134394702
N-(2,2-dimethoxyethyl)-3-[2-[3-[2-[4-(4-ethyl-2-pyridinyl)-1-oxa-4,9-diazaspiro[5.5]undecan-9-yl]ethyl]phenyl]ethoxy]-N-methylpropanamide (PubChem CID 134394702) has the molecular formula C33H50N4O5 and a molecular weight of 582.79 g/mol. Its IUPAC name is N-(2,2-dimethoxyethyl)-3-[2-[3-[2-[4-(4-ethyl-2-pyridinyl)-1-oxa-4,9-diazaspiro[5.5]undecan-9-yl]ethyl]phenyl]ethoxy]-N-methylpropanamide.
| Compound Name | N-(2,2-dimethoxyethyl)-3-[2-[3-[2-[4-(4-ethyl-2-pyridinyl)-1-oxa-4,9-diazaspiro[5.5]undecan-9-yl]ethyl]phenyl]ethoxy]-N-methylpropanamide |
|---|---|
| PubChem CID | 134394702 |
| Molecular Formula | C33H50N4O5 |
| Molecular Weight | 582.79 g/mol |
| Exact Mass | 582.38 |
| IUPAC Name | N-(2,2-dimethoxyethyl)-3-[2-[3-[2-[4-(4-ethyl-2-pyridinyl)-1-oxa-4,9-diazaspiro[5.5]undecan-9-yl]ethyl]phenyl]ethoxy]-N-methylpropanamide |
| SMILES | CCc1ccnc(N2CCOC3(CCN(CCc4cccc(CCOCCC(=O)N(C)CC(OC)OC)c4)CC3)C2)c1 |
| InChI | InChI=1S/C33H50N4O5/c1-5-27-9-15-34-30(24-27)37-19-22-42-33(26-37)13-17-36(18-14-33)16-10-28-7-6-8-29(23-28)11-20-41-21-12-31(38)35(2)25-32(39-3)40-4/h6-9,15,23-24,32H,5,10-14,16-22,25-26H2,1-4H3 |
| InChIKey | QVSURLSLEJCCGG-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 76.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.79 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|