C32H48N4O5 — CID 134394744
N-(2,2-dimethoxyethyl)-3-[2-[3-[[4-(4-ethyl-2-pyridinyl)-1-oxa-4,9-diazaspiro[5.5]undecan-9-yl]methyl]phenyl]ethoxy]-N-methylpropanamide (PubChem CID 134394744) has the molecular formula C32H48N4O5 and a molecular weight of 568.76 g/mol. Its IUPAC name is N-(2,2-dimethoxyethyl)-3-[2-[3-[[4-(4-ethyl-2-pyridinyl)-1-oxa-4,9-diazaspiro[5.5]undecan-9-yl]methyl]phenyl]ethoxy]-N-methylpropanamide.
| Compound Name | N-(2,2-dimethoxyethyl)-3-[2-[3-[[4-(4-ethyl-2-pyridinyl)-1-oxa-4,9-diazaspiro[5.5]undecan-9-yl]methyl]phenyl]ethoxy]-N-methylpropanamide |
|---|---|
| PubChem CID | 134394744 |
| Molecular Formula | C32H48N4O5 |
| Molecular Weight | 568.76 g/mol |
| Exact Mass | 568.36 |
| IUPAC Name | N-(2,2-dimethoxyethyl)-3-[2-[3-[[4-(4-ethyl-2-pyridinyl)-1-oxa-4,9-diazaspiro[5.5]undecan-9-yl]methyl]phenyl]ethoxy]-N-methylpropanamide |
| SMILES | CCc1ccnc(N2CCOC3(CCN(Cc4cccc(CCOCCC(=O)N(C)CC(OC)OC)c4)CC3)C2)c1 |
| InChI | InChI=1S/C32H48N4O5/c1-5-26-9-14-33-29(22-26)36-17-20-41-32(25-36)12-15-35(16-13-32)23-28-8-6-7-27(21-28)10-18-40-19-11-30(37)34(2)24-31(38-3)39-4/h6-9,14,21-22,31H,5,10-13,15-20,23-25H2,1-4H3 |
| InChIKey | KKYSJTHHMIANMV-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 76.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.76 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|