About 7-(2-fluoro-4-methylcyclobuta-1,3-dien-1-yl)hepta-4,6-diyn-1-ol
7-(2-fluoro-4-methylcyclobuta-1,3-dien-1-yl)hepta-4,6-diyn-1-ol (PubChem CID 134394940) has the molecular formula C12H11FO
and a molecular weight of 190.22 g/mol. Its IUPAC name is 7-(2-fluoro-4-methylcyclobuta-1,3-dien-1-yl)hepta-4,6-diyn-1-ol.
Molecular Properties
| Compound Name | 7-(2-fluoro-4-methylcyclobuta-1,3-dien-1-yl)hepta-4,6-diyn-1-ol |
| PubChem CID | 134394940 |
| Molecular Formula | C12H11FO |
| Molecular Weight | 190.22 g/mol |
| Exact Mass | 190.08 |
| IUPAC Name | 7-(2-fluoro-4-methylcyclobuta-1,3-dien-1-yl)hepta-4,6-diyn-1-ol |
| SMILES | CC1=CC(F)=C1C#CC#CCCCO |
| InChI | InChI=1S/C12H11FO/c1-10-9-12(13)11(10)7-5-3-2-4-6-8-14/h9,14H,4,6,8H2,1H3 |
| InChIKey | MAPZSKOJNCBMMZ-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.22 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 7-(2-fluoro-4-methylcyclobuta-1,3-dien-1-yl)hepta-4,6-diyn-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(2-fluoro-4-methylcyclobuta-1,3-dien-1-yl)hepta-4,6-diyn-1-ol?
The IUPAC name of 7-(2-fluoro-4-methylcyclobuta-1,3-dien-1-yl)hepta-4,6-diyn-1-ol (CID 134394940) is 7-(2-fluoro-4-methylcyclobuta-1,3-dien-1-yl)hepta-4,6-diyn-1-ol.
What is the SMILES notation for 7-(2-fluoro-4-methylcyclobuta-1,3-dien-1-yl)hepta-4,6-diyn-1-ol?
The canonical SMILES for 7-(2-fluoro-4-methylcyclobuta-1,3-dien-1-yl)hepta-4,6-diyn-1-ol is CC1=CC(F)=C1C#CC#CCCCO.
What is the InChIKey of 7-(2-fluoro-4-methylcyclobuta-1,3-dien-1-yl)hepta-4,6-diyn-1-ol?
The InChIKey is MAPZSKOJNCBMMZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11FO/c1-10-9-12(13)11(10)7-5-3-2-4-6-8-14/h9,14H,4,6,8H2,1H3.
What are the key properties of 7-(2-fluoro-4-methylcyclobuta-1,3-dien-1-yl)hepta-4,6-diyn-1-ol?
7-(2-fluoro-4-methylcyclobuta-1,3-dien-1-yl)hepta-4,6-diyn-1-ol has a molecular weight of 190.22 g/mol, XLogP of 1.95, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(2-fluoro-4-methylcyclobuta-1,3-dien-1-yl)hepta-4,6-diyn-1-ol is sourced from PubChem (CID 134394940), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).