About CID 13439499
CID 13439499 (PubChem CID 13439499) has the molecular formula C9H10NSe
and a molecular weight of 211.15 g/mol.
Molecular Properties
| Compound Name | CID 13439499 |
| PubChem CID | 13439499 |
| Molecular Formula | C9H10NSe |
| Molecular Weight | 211.15 g/mol |
| Exact Mass | 212.00 |
| IUPAC Name | — |
| SMILES | C/C([Se])=N\Cc1ccccc1 |
| InChI | InChI=1S/C9H10NSe/c1-8(11)10-7-9-5-3-2-4-6-9/h2-6H,7H2,1H3/b10-8+ |
| InChIKey | JHTVHYNZMYGRBT-CSKARUKUSA-N |
| XLogP | 1.77 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.15 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze CID 13439499 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 13439499?
The IUPAC name of CID 13439499 (CID 13439499) is not available.
What is the SMILES notation for CID 13439499?
The canonical SMILES for CID 13439499 is C/C([Se])=N\Cc1ccccc1.
What is the InChIKey of CID 13439499?
The InChIKey is JHTVHYNZMYGRBT-CSKARUKUSA-N. The full InChI is InChI=1S/C9H10NSe/c1-8(11)10-7-9-5-3-2-4-6-9/h2-6H,7H2,1H3/b10-8+.
What are the key properties of CID 13439499?
CID 13439499 has a molecular weight of 211.15 g/mol, XLogP of 1.77, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 13439499 is sourced from PubChem (CID 13439499), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).