About tert-butyl N-[(2Z)-3-methoxypenta-2,4-dien-2-yl]-N-methylcarbamate
tert-butyl N-[(2Z)-3-methoxypenta-2,4-dien-2-yl]-N-methylcarbamate (PubChem CID 134395746) has the molecular formula C12H21NO3
and a molecular weight of 227.30 g/mol. Its IUPAC name is tert-butyl N-[(2Z)-3-methoxypenta-2,4-dien-2-yl]-N-methylcarbamate.
Molecular Properties
| Compound Name | tert-butyl N-[(2Z)-3-methoxypenta-2,4-dien-2-yl]-N-methylcarbamate |
| PubChem CID | 134395746 |
| Molecular Formula | C12H21NO3 |
| Molecular Weight | 227.30 g/mol |
| Exact Mass | 227.15 |
| IUPAC Name | tert-butyl N-[(2Z)-3-methoxypenta-2,4-dien-2-yl]-N-methylcarbamate |
| SMILES | C=C/C(OC)=C(\C)N(C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C12H21NO3/c1-8-10(15-7)9(2)13(6)11(14)16-12(3,4)5/h8H,1H2,2-7H3/b10-9- |
| InChIKey | RIAILTIYGRFLHW-KTKRTIGZSA-N |
| XLogP | 2.92 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.30 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl N-[(2Z)-3-methoxypenta-2,4-dien-2-yl]-N-methylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-[(2Z)-3-methoxypenta-2,4-dien-2-yl]-N-methylcarbamate?
The IUPAC name of tert-butyl N-[(2Z)-3-methoxypenta-2,4-dien-2-yl]-N-methylcarbamate (CID 134395746) is tert-butyl N-[(2Z)-3-methoxypenta-2,4-dien-2-yl]-N-methylcarbamate.
What is the SMILES notation for tert-butyl N-[(2Z)-3-methoxypenta-2,4-dien-2-yl]-N-methylcarbamate?
The canonical SMILES for tert-butyl N-[(2Z)-3-methoxypenta-2,4-dien-2-yl]-N-methylcarbamate is C=C/C(OC)=C(\C)N(C)C(=O)OC(C)(C)C.
What is the InChIKey of tert-butyl N-[(2Z)-3-methoxypenta-2,4-dien-2-yl]-N-methylcarbamate?
The InChIKey is RIAILTIYGRFLHW-KTKRTIGZSA-N. The full InChI is InChI=1S/C12H21NO3/c1-8-10(15-7)9(2)13(6)11(14)16-12(3,4)5/h8H,1H2,2-7H3/b10-9-.
What are the key properties of tert-butyl N-[(2Z)-3-methoxypenta-2,4-dien-2-yl]-N-methylcarbamate?
tert-butyl N-[(2Z)-3-methoxypenta-2,4-dien-2-yl]-N-methylcarbamate has a molecular weight of 227.30 g/mol, XLogP of 2.92, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-[(2Z)-3-methoxypenta-2,4-dien-2-yl]-N-methylcarbamate is sourced from PubChem (CID 134395746), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).