About 2-[(3Z)-3-[(2Z)-penta-2,4-dienylidene]-1-phenyl-2H-phosphol-4-yl]aniline
2-[(3Z)-3-[(2Z)-penta-2,4-dienylidene]-1-phenyl-2H-phosphol-4-yl]aniline (PubChem CID 134395876) has the molecular formula C21H20NP
and a molecular weight of 317.37 g/mol. Its IUPAC name is 2-[(3Z)-3-[(2Z)-penta-2,4-dienylidene]-1-phenyl-2H-phosphol-4-yl]aniline.
Molecular Properties
| Compound Name | 2-[(3Z)-3-[(2Z)-penta-2,4-dienylidene]-1-phenyl-2H-phosphol-4-yl]aniline |
| PubChem CID | 134395876 |
| Molecular Formula | C21H20NP |
| Molecular Weight | 317.37 g/mol |
| Exact Mass | 317.13 |
| IUPAC Name | 2-[(3Z)-3-[(2Z)-penta-2,4-dienylidene]-1-phenyl-2H-phosphol-4-yl]aniline |
| SMILES | C=C/C=C\C=C1/CP(c2ccccc2)C=C1c1ccccc1N |
| InChI | InChI=1S/C21H20NP/c1-2-3-5-10-17-15-23(18-11-6-4-7-12-18)16-20(17)19-13-8-9-14-21(19)22/h2-14,16H,1,15,22H2/b5-3-,17-10+ |
| InChIKey | RLYBSELJUQQTFW-MSFFHYLASA-N |
| XLogP | 5.10 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 317.37 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 2-[(3Z)-3-[(2Z)-penta-2,4-dienylidene]-1-phenyl-2H-phosphol-4-yl]aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(3Z)-3-[(2Z)-penta-2,4-dienylidene]-1-phenyl-2H-phosphol-4-yl]aniline?
The IUPAC name of 2-[(3Z)-3-[(2Z)-penta-2,4-dienylidene]-1-phenyl-2H-phosphol-4-yl]aniline (CID 134395876) is 2-[(3Z)-3-[(2Z)-penta-2,4-dienylidene]-1-phenyl-2H-phosphol-4-yl]aniline.
What is the SMILES notation for 2-[(3Z)-3-[(2Z)-penta-2,4-dienylidene]-1-phenyl-2H-phosphol-4-yl]aniline?
The canonical SMILES for 2-[(3Z)-3-[(2Z)-penta-2,4-dienylidene]-1-phenyl-2H-phosphol-4-yl]aniline is C=C/C=C\C=C1/CP(c2ccccc2)C=C1c1ccccc1N.
What is the InChIKey of 2-[(3Z)-3-[(2Z)-penta-2,4-dienylidene]-1-phenyl-2H-phosphol-4-yl]aniline?
The InChIKey is RLYBSELJUQQTFW-MSFFHYLASA-N. The full InChI is InChI=1S/C21H20NP/c1-2-3-5-10-17-15-23(18-11-6-4-7-12-18)16-20(17)19-13-8-9-14-21(19)22/h2-14,16H,1,15,22H2/b5-3-,17-10+.
What are the key properties of 2-[(3Z)-3-[(2Z)-penta-2,4-dienylidene]-1-phenyl-2H-phosphol-4-yl]aniline?
2-[(3Z)-3-[(2Z)-penta-2,4-dienylidene]-1-phenyl-2H-phosphol-4-yl]aniline has a molecular weight of 317.37 g/mol, XLogP of 5.10, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(3Z)-3-[(2Z)-penta-2,4-dienylidene]-1-phenyl-2H-phosphol-4-yl]aniline is sourced from PubChem (CID 134395876), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).