C14H26N2 — CID 134396140
N'-[(1E,3Z)-2-tert-butylpenta-1,3-dienyl]-2,2-dimethylpropanimidamide (PubChem CID 134396140) has the molecular formula C14H26N2 and a molecular weight of 222.38 g/mol. Its IUPAC name is N'-[(1E,3Z)-2-tert-butylpenta-1,3-dienyl]-2,2-dimethylpropanimidamide.
| Compound Name | N'-[(1E,3Z)-2-tert-butylpenta-1,3-dienyl]-2,2-dimethylpropanimidamide |
|---|---|
| PubChem CID | 134396140 |
| Molecular Formula | C14H26N2 |
| Molecular Weight | 222.38 g/mol |
| Exact Mass | 222.21 |
| IUPAC Name | N'-[(1E,3Z)-2-tert-butylpenta-1,3-dienyl]-2,2-dimethylpropanimidamide |
| SMILES | C/C=C\C(=C/N=C(\N)C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C14H26N2/c1-8-9-11(13(2,3)4)10-16-12(15)14(5,6)7/h8-10H,1-7H3,(H2,15,16)/b9-8-,11-10+ |
| InChIKey | OZLAAAVDBHMQSU-QNRZBPGKSA-N |
| XLogP | 3.90 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.38 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|