C21H17N5O3S — CID 134396771
N-(4-amino-3,4-dioxo-1-phenylbutan-2-yl)-4-indazol-1-yl-1,3-thiazole-5-carboxamide (PubChem CID 134396771) has the molecular formula C21H17N5O3S and a molecular weight of 419.47 g/mol. Its IUPAC name is N-(4-amino-3,4-dioxo-1-phenylbutan-2-yl)-4-indazol-1-yl-1,3-thiazole-5-carboxamide.
| Compound Name | N-(4-amino-3,4-dioxo-1-phenylbutan-2-yl)-4-indazol-1-yl-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 134396771 |
| Molecular Formula | C21H17N5O3S |
| Molecular Weight | 419.47 g/mol |
| Exact Mass | 419.11 |
| IUPAC Name | N-(4-amino-3,4-dioxo-1-phenylbutan-2-yl)-4-indazol-1-yl-1,3-thiazole-5-carboxamide |
| SMILES | NC(=O)C(=O)C(Cc1ccccc1)NC(=O)c1scnc1-n1ncc2ccccc21 |
| InChI | InChI=1S/C21H17N5O3S/c22-19(28)17(27)15(10-13-6-2-1-3-7-13)25-21(29)18-20(23-12-30-18)26-16-9-5-4-8-14(16)11-24-26/h1-9,11-12,15H,10H2,(H2,22,28)(H,25,29) |
| InChIKey | BUXCBFWZMNCMPI-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 119.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.47 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|