C22H19N5O4 — CID 134397015
N-(4-amino-3,4-dioxo-1-phenylbutan-2-yl)-5-indazol-2-yl-3-methyl-1,2-oxazole-4-carboxamide (PubChem CID 134397015) has the molecular formula C22H19N5O4 and a molecular weight of 417.43 g/mol. Its IUPAC name is N-(4-amino-3,4-dioxo-1-phenylbutan-2-yl)-5-indazol-2-yl-3-methyl-1,2-oxazole-4-carboxamide.
| Compound Name | N-(4-amino-3,4-dioxo-1-phenylbutan-2-yl)-5-indazol-2-yl-3-methyl-1,2-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 134397015 |
| Molecular Formula | C22H19N5O4 |
| Molecular Weight | 417.43 g/mol |
| Exact Mass | 417.14 |
| IUPAC Name | N-(4-amino-3,4-dioxo-1-phenylbutan-2-yl)-5-indazol-2-yl-3-methyl-1,2-oxazole-4-carboxamide |
| SMILES | Cc1noc(-n2cc3ccccc3n2)c1C(=O)NC(Cc1ccccc1)C(=O)C(N)=O |
| InChI | InChI=1S/C22H19N5O4/c1-13-18(22(31-26-13)27-12-15-9-5-6-10-16(15)25-27)21(30)24-17(19(28)20(23)29)11-14-7-3-2-4-8-14/h2-10,12,17H,11H2,1H3,(H2,23,29)(H,24,30) |
| InChIKey | OPHHWWQPSQWZBE-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 133.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.43 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|