About 1-(2-chloropyrimidin-4-yl)-1,2-dimethylhydrazine
1-(2-chloropyrimidin-4-yl)-1,2-dimethylhydrazine (PubChem CID 134397137) has the molecular formula C6H9ClN4
and a molecular weight of 172.62 g/mol. Its IUPAC name is 1-(2-chloropyrimidin-4-yl)-1,2-dimethylhydrazine.
Molecular Properties
| Compound Name | 1-(2-chloropyrimidin-4-yl)-1,2-dimethylhydrazine |
| PubChem CID | 134397137 |
| Molecular Formula | C6H9ClN4 |
| Molecular Weight | 172.62 g/mol |
| Exact Mass | 172.05 |
| IUPAC Name | 1-(2-chloropyrimidin-4-yl)-1,2-dimethylhydrazine |
| SMILES | CNN(C)c1ccnc(Cl)n1 |
| InChI | InChI=1S/C6H9ClN4/c1-8-11(2)5-3-4-9-6(7)10-5/h3-4,8H,1-2H3 |
| InChIKey | RMQFAUWELBRPGB-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.62 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-(2-chloropyrimidin-4-yl)-1,2-dimethylhydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-chloropyrimidin-4-yl)-1,2-dimethylhydrazine?
The IUPAC name of 1-(2-chloropyrimidin-4-yl)-1,2-dimethylhydrazine (CID 134397137) is 1-(2-chloropyrimidin-4-yl)-1,2-dimethylhydrazine.
What is the SMILES notation for 1-(2-chloropyrimidin-4-yl)-1,2-dimethylhydrazine?
The canonical SMILES for 1-(2-chloropyrimidin-4-yl)-1,2-dimethylhydrazine is CNN(C)c1ccnc(Cl)n1.
What is the InChIKey of 1-(2-chloropyrimidin-4-yl)-1,2-dimethylhydrazine?
The InChIKey is RMQFAUWELBRPGB-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9ClN4/c1-8-11(2)5-3-4-9-6(7)10-5/h3-4,8H,1-2H3.
What are the key properties of 1-(2-chloropyrimidin-4-yl)-1,2-dimethylhydrazine?
1-(2-chloropyrimidin-4-yl)-1,2-dimethylhydrazine has a molecular weight of 172.62 g/mol, XLogP of 0.70, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-chloropyrimidin-4-yl)-1,2-dimethylhydrazine is sourced from PubChem (CID 134397137), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).