About 5-methyl-1-(1,3-thiazol-2-yl)pyrazole-3-carboxylic acid
5-methyl-1-(1,3-thiazol-2-yl)pyrazole-3-carboxylic acid (PubChem CID 134397342) has the molecular formula C8H7N3O2S
and a molecular weight of 209.23 g/mol. Its IUPAC name is 5-methyl-1-(1,3-thiazol-2-yl)pyrazole-3-carboxylic acid.
Molecular Properties
| Compound Name | 5-methyl-1-(1,3-thiazol-2-yl)pyrazole-3-carboxylic acid |
| PubChem CID | 134397342 |
| Molecular Formula | C8H7N3O2S |
| Molecular Weight | 209.23 g/mol |
| Exact Mass | 209.03 |
| IUPAC Name | 5-methyl-1-(1,3-thiazol-2-yl)pyrazole-3-carboxylic acid |
| SMILES | Cc1cc(C(=O)O)nn1-c1nccs1 |
| InChI | InChI=1S/C8H7N3O2S/c1-5-4-6(7(12)13)10-11(5)8-9-2-3-14-8/h2-4H,1H3,(H,12,13) |
| InChIKey | BAIKGGXMXXNLEP-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.23 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-methyl-1-(1,3-thiazol-2-yl)pyrazole-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-1-(1,3-thiazol-2-yl)pyrazole-3-carboxylic acid?
The IUPAC name of 5-methyl-1-(1,3-thiazol-2-yl)pyrazole-3-carboxylic acid (CID 134397342) is 5-methyl-1-(1,3-thiazol-2-yl)pyrazole-3-carboxylic acid.
What is the SMILES notation for 5-methyl-1-(1,3-thiazol-2-yl)pyrazole-3-carboxylic acid?
The canonical SMILES for 5-methyl-1-(1,3-thiazol-2-yl)pyrazole-3-carboxylic acid is Cc1cc(C(=O)O)nn1-c1nccs1.
What is the InChIKey of 5-methyl-1-(1,3-thiazol-2-yl)pyrazole-3-carboxylic acid?
The InChIKey is BAIKGGXMXXNLEP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7N3O2S/c1-5-4-6(7(12)13)10-11(5)8-9-2-3-14-8/h2-4H,1H3,(H,12,13).
What are the key properties of 5-methyl-1-(1,3-thiazol-2-yl)pyrazole-3-carboxylic acid?
5-methyl-1-(1,3-thiazol-2-yl)pyrazole-3-carboxylic acid has a molecular weight of 209.23 g/mol, XLogP of 1.34, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-1-(1,3-thiazol-2-yl)pyrazole-3-carboxylic acid is sourced from PubChem (CID 134397342), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).