About 5-chloro-3-propan-2-yl-1,2-dihydropyridin-2-ol
5-chloro-3-propan-2-yl-1,2-dihydropyridin-2-ol (PubChem CID 134397914) has the molecular formula C8H12ClNO
and a molecular weight of 173.64 g/mol. Its IUPAC name is 5-chloro-3-propan-2-yl-1,2-dihydropyridin-2-ol.
Molecular Properties
| Compound Name | 5-chloro-3-propan-2-yl-1,2-dihydropyridin-2-ol |
| PubChem CID | 134397914 |
| Molecular Formula | C8H12ClNO |
| Molecular Weight | 173.64 g/mol |
| Exact Mass | 173.06 |
| IUPAC Name | 5-chloro-3-propan-2-yl-1,2-dihydropyridin-2-ol |
| SMILES | CC(C)C1=CC(Cl)=CNC1O |
| InChI | InChI=1S/C8H12ClNO/c1-5(2)7-3-6(9)4-10-8(7)11/h3-5,8,10-11H,1-2H3 |
| InChIKey | IISXWTVUPAKTAV-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.64 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-chloro-3-propan-2-yl-1,2-dihydropyridin-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-3-propan-2-yl-1,2-dihydropyridin-2-ol?
The IUPAC name of 5-chloro-3-propan-2-yl-1,2-dihydropyridin-2-ol (CID 134397914) is 5-chloro-3-propan-2-yl-1,2-dihydropyridin-2-ol.
What is the SMILES notation for 5-chloro-3-propan-2-yl-1,2-dihydropyridin-2-ol?
The canonical SMILES for 5-chloro-3-propan-2-yl-1,2-dihydropyridin-2-ol is CC(C)C1=CC(Cl)=CNC1O.
What is the InChIKey of 5-chloro-3-propan-2-yl-1,2-dihydropyridin-2-ol?
The InChIKey is IISXWTVUPAKTAV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12ClNO/c1-5(2)7-3-6(9)4-10-8(7)11/h3-5,8,10-11H,1-2H3.
What are the key properties of 5-chloro-3-propan-2-yl-1,2-dihydropyridin-2-ol?
5-chloro-3-propan-2-yl-1,2-dihydropyridin-2-ol has a molecular weight of 173.64 g/mol, XLogP of 1.57, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-3-propan-2-yl-1,2-dihydropyridin-2-ol is sourced from PubChem (CID 134397914), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).