About 3-[6-(3-cyanophenyl)-[1,3]oxazolo[5,4-b]pyridin-2-yl]-3-fluoropiperidine-1-carbonitrile
3-[6-(3-cyanophenyl)-[1,3]oxazolo[5,4-b]pyridin-2-yl]-3-fluoropiperidine-1-carbonitrile (PubChem CID 134397968) has the molecular formula C19H14FN5O
and a molecular weight of 347.35 g/mol. Its IUPAC name is 3-[6-(3-cyanophenyl)-[1,3]oxazolo[5,4-b]pyridin-2-yl]-3-fluoropiperidine-1-carbonitrile.
Molecular Properties
| Compound Name | 3-[6-(3-cyanophenyl)-[1,3]oxazolo[5,4-b]pyridin-2-yl]-3-fluoropiperidine-1-carbonitrile |
| PubChem CID | 134397968 |
| Molecular Formula | C19H14FN5O |
| Molecular Weight | 347.35 g/mol |
| Exact Mass | 347.12 |
| IUPAC Name | 3-[6-(3-cyanophenyl)-[1,3]oxazolo[5,4-b]pyridin-2-yl]-3-fluoropiperidine-1-carbonitrile |
| SMILES | N#Cc1cccc(-c2cnc3oc(C4(F)CCCN(C#N)C4)nc3c2)c1 |
| InChI | InChI=1S/C19H14FN5O/c20-19(5-2-6-25(11-19)12-22)18-24-16-8-15(10-23-17(16)26-18)14-4-1-3-13(7-14)9-21/h1,3-4,7-8,10H,2,5-6,11H2 |
| InChIKey | ZDBVUTDCCAWUJF-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 89.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 347.35 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|
Analyze 3-[6-(3-cyanophenyl)-[1,3]oxazolo[5,4-b]pyridin-2-yl]-3-fluoropiperidine-1-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[6-(3-cyanophenyl)-[1,3]oxazolo[5,4-b]pyridin-2-yl]-3-fluoropiperidine-1-carbonitrile?
The IUPAC name of 3-[6-(3-cyanophenyl)-[1,3]oxazolo[5,4-b]pyridin-2-yl]-3-fluoropiperidine-1-carbonitrile (CID 134397968) is 3-[6-(3-cyanophenyl)-[1,3]oxazolo[5,4-b]pyridin-2-yl]-3-fluoropiperidine-1-carbonitrile.
What is the SMILES notation for 3-[6-(3-cyanophenyl)-[1,3]oxazolo[5,4-b]pyridin-2-yl]-3-fluoropiperidine-1-carbonitrile?
The canonical SMILES for 3-[6-(3-cyanophenyl)-[1,3]oxazolo[5,4-b]pyridin-2-yl]-3-fluoropiperidine-1-carbonitrile is N#Cc1cccc(-c2cnc3oc(C4(F)CCCN(C#N)C4)nc3c2)c1.
What is the InChIKey of 3-[6-(3-cyanophenyl)-[1,3]oxazolo[5,4-b]pyridin-2-yl]-3-fluoropiperidine-1-carbonitrile?
The InChIKey is ZDBVUTDCCAWUJF-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H14FN5O/c20-19(5-2-6-25(11-19)12-22)18-24-16-8-15(10-23-17(16)26-18)14-4-1-3-13(7-14)9-21/h1,3-4,7-8,10H,2,5-6,11H2.
What are the key properties of 3-[6-(3-cyanophenyl)-[1,3]oxazolo[5,4-b]pyridin-2-yl]-3-fluoropiperidine-1-carbonitrile?
3-[6-(3-cyanophenyl)-[1,3]oxazolo[5,4-b]pyridin-2-yl]-3-fluoropiperidine-1-carbonitrile has a molecular weight of 347.35 g/mol, XLogP of 3.50, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[6-(3-cyanophenyl)-[1,3]oxazolo[5,4-b]pyridin-2-yl]-3-fluoropiperidine-1-carbonitrile is sourced from PubChem (CID 134397968), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).