C17H29N — CID 134397975
3-but-1-en-2-yl-1-(5,5-dimethylhexa-1,2-dien-3-yl)piperidine (PubChem CID 134397975) has the molecular formula C17H29N and a molecular weight of 247.43 g/mol. Its IUPAC name is 3-but-1-en-2-yl-1-(5,5-dimethylhexa-1,2-dien-3-yl)piperidine.
| Compound Name | 3-but-1-en-2-yl-1-(5,5-dimethylhexa-1,2-dien-3-yl)piperidine |
|---|---|
| PubChem CID | 134397975 |
| Molecular Formula | C17H29N |
| Molecular Weight | 247.43 g/mol |
| Exact Mass | 247.23 |
| IUPAC Name | 3-but-1-en-2-yl-1-(5,5-dimethylhexa-1,2-dien-3-yl)piperidine |
| SMILES | C=C=C(CC(C)(C)C)N1CCCC(C(=C)CC)C1 |
| InChI | InChI=1S/C17H29N/c1-7-14(3)15-10-9-11-18(13-15)16(8-2)12-17(4,5)6/h15H,2-3,7,9-13H2,1,4-6H3 |
| InChIKey | LLQKIXBTDHEAMQ-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.43 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|