About N-(1,5-dimethyl-3,6-dihydro-2H-pyridin-3-yl)-N-(2-methylpropoxy)formamide
N-(1,5-dimethyl-3,6-dihydro-2H-pyridin-3-yl)-N-(2-methylpropoxy)formamide (PubChem CID 134398301) has the molecular formula C12H22N2O2
and a molecular weight of 226.32 g/mol. Its IUPAC name is N-(1,5-dimethyl-3,6-dihydro-2H-pyridin-3-yl)-N-(2-methylpropoxy)formamide.
Molecular Properties
| Compound Name | N-(1,5-dimethyl-3,6-dihydro-2H-pyridin-3-yl)-N-(2-methylpropoxy)formamide |
| PubChem CID | 134398301 |
| Molecular Formula | C12H22N2O2 |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.17 |
| IUPAC Name | N-(1,5-dimethyl-3,6-dihydro-2H-pyridin-3-yl)-N-(2-methylpropoxy)formamide |
| SMILES | CC1=CC(N(C=O)OCC(C)C)CN(C)C1 |
| InChI | InChI=1S/C12H22N2O2/c1-10(2)8-16-14(9-15)12-5-11(3)6-13(4)7-12/h5,9-10,12H,6-8H2,1-4H3 |
| InChIKey | QURWOHXHOFVYNB-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-(1,5-dimethyl-3,6-dihydro-2H-pyridin-3-yl)-N-(2-methylpropoxy)formamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1,5-dimethyl-3,6-dihydro-2H-pyridin-3-yl)-N-(2-methylpropoxy)formamide?
The IUPAC name of N-(1,5-dimethyl-3,6-dihydro-2H-pyridin-3-yl)-N-(2-methylpropoxy)formamide (CID 134398301) is N-(1,5-dimethyl-3,6-dihydro-2H-pyridin-3-yl)-N-(2-methylpropoxy)formamide.
What is the SMILES notation for N-(1,5-dimethyl-3,6-dihydro-2H-pyridin-3-yl)-N-(2-methylpropoxy)formamide?
The canonical SMILES for N-(1,5-dimethyl-3,6-dihydro-2H-pyridin-3-yl)-N-(2-methylpropoxy)formamide is CC1=CC(N(C=O)OCC(C)C)CN(C)C1.
What is the InChIKey of N-(1,5-dimethyl-3,6-dihydro-2H-pyridin-3-yl)-N-(2-methylpropoxy)formamide?
The InChIKey is QURWOHXHOFVYNB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22N2O2/c1-10(2)8-16-14(9-15)12-5-11(3)6-13(4)7-12/h5,9-10,12H,6-8H2,1-4H3.
What are the key properties of N-(1,5-dimethyl-3,6-dihydro-2H-pyridin-3-yl)-N-(2-methylpropoxy)formamide?
N-(1,5-dimethyl-3,6-dihydro-2H-pyridin-3-yl)-N-(2-methylpropoxy)formamide has a molecular weight of 226.32 g/mol, XLogP of 1.29, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1,5-dimethyl-3,6-dihydro-2H-pyridin-3-yl)-N-(2-methylpropoxy)formamide is sourced from PubChem (CID 134398301), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).