About 2,5-dimethylhexan-2-yl 3-[[1-(trifluoromethyl)cyclopropyl]methoxy]pyrazole-1-carboxylate
2,5-dimethylhexan-2-yl 3-[[1-(trifluoromethyl)cyclopropyl]methoxy]pyrazole-1-carboxylate (PubChem CID 134398718) has the molecular formula C17H25F3N2O3
and a molecular weight of 362.39 g/mol. Its IUPAC name is 2,5-dimethylhexan-2-yl 3-[[1-(trifluoromethyl)cyclopropyl]methoxy]pyrazole-1-carboxylate.
Molecular Properties
| Compound Name | 2,5-dimethylhexan-2-yl 3-[[1-(trifluoromethyl)cyclopropyl]methoxy]pyrazole-1-carboxylate |
| PubChem CID | 134398718 |
| Molecular Formula | C17H25F3N2O3 |
| Molecular Weight | 362.39 g/mol |
| Exact Mass | 362.18 |
| IUPAC Name | 2,5-dimethylhexan-2-yl 3-[[1-(trifluoromethyl)cyclopropyl]methoxy]pyrazole-1-carboxylate |
| SMILES | CC(C)CCC(C)(C)OC(=O)n1ccc(OCC2(C(F)(F)F)CC2)n1 |
| InChI | InChI=1S/C17H25F3N2O3/c1-12(2)5-7-15(3,4)25-14(23)22-10-6-13(21-22)24-11-16(8-9-16)17(18,19)20/h6,10,12H,5,7-9,11H2,1-4H3 |
| InChIKey | PLIFTNGXBMVVFI-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 362.39 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2,5-dimethylhexan-2-yl 3-[[1-(trifluoromethyl)cyclopropyl]methoxy]pyrazole-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-dimethylhexan-2-yl 3-[[1-(trifluoromethyl)cyclopropyl]methoxy]pyrazole-1-carboxylate?
The IUPAC name of 2,5-dimethylhexan-2-yl 3-[[1-(trifluoromethyl)cyclopropyl]methoxy]pyrazole-1-carboxylate (CID 134398718) is 2,5-dimethylhexan-2-yl 3-[[1-(trifluoromethyl)cyclopropyl]methoxy]pyrazole-1-carboxylate.
What is the SMILES notation for 2,5-dimethylhexan-2-yl 3-[[1-(trifluoromethyl)cyclopropyl]methoxy]pyrazole-1-carboxylate?
The canonical SMILES for 2,5-dimethylhexan-2-yl 3-[[1-(trifluoromethyl)cyclopropyl]methoxy]pyrazole-1-carboxylate is CC(C)CCC(C)(C)OC(=O)n1ccc(OCC2(C(F)(F)F)CC2)n1.
What is the InChIKey of 2,5-dimethylhexan-2-yl 3-[[1-(trifluoromethyl)cyclopropyl]methoxy]pyrazole-1-carboxylate?
The InChIKey is PLIFTNGXBMVVFI-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H25F3N2O3/c1-12(2)5-7-15(3,4)25-14(23)22-10-6-13(21-22)24-11-16(8-9-16)17(18,19)20/h6,10,12H,5,7-9,11H2,1-4H3.
What are the key properties of 2,5-dimethylhexan-2-yl 3-[[1-(trifluoromethyl)cyclopropyl]methoxy]pyrazole-1-carboxylate?
2,5-dimethylhexan-2-yl 3-[[1-(trifluoromethyl)cyclopropyl]methoxy]pyrazole-1-carboxylate has a molecular weight of 362.39 g/mol, XLogP of 4.80, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-dimethylhexan-2-yl 3-[[1-(trifluoromethyl)cyclopropyl]methoxy]pyrazole-1-carboxylate is sourced from PubChem (CID 134398718), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).