C32H39F3IN5O4S — CID 134398742
N-(benzenesulfonyl)-2-[(4S)-4-ethyl-2-(4-iodobutyl)-2-methylpyrrolidin-1-yl]-6-[3-[2-[1-(trifluoromethyl)cyclopropyl]ethoxy]pyrazol-1-yl]pyridine-3-carboxamide (PubChem CID 134398742) has the molecular formula C32H39F3IN5O4S and a molecular weight of 773.66 g/mol. Its IUPAC name is N-(benzenesulfonyl)-2-[(4S)-4-ethyl-2-(4-iodobutyl)-2-methylpyrrolidin-1-yl]-6-[3-[2-[1-(trifluoromethyl)cyclopropyl]ethoxy]pyrazol-1-yl]pyridine-3-carboxamide.
| Compound Name | N-(benzenesulfonyl)-2-[(4S)-4-ethyl-2-(4-iodobutyl)-2-methylpyrrolidin-1-yl]-6-[3-[2-[1-(trifluoromethyl)cyclopropyl]ethoxy]pyrazol-1-yl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 134398742 |
| Molecular Formula | C32H39F3IN5O4S |
| Molecular Weight | 773.66 g/mol |
| Exact Mass | 773.17 |
| IUPAC Name | N-(benzenesulfonyl)-2-[(4S)-4-ethyl-2-(4-iodobutyl)-2-methylpyrrolidin-1-yl]-6-[3-[2-[1-(trifluoromethyl)cyclopropyl]ethoxy]pyrazol-1-yl]pyridine-3-carboxamide |
| SMILES | CC[C@@H]1CN(c2nc(-n3ccc(OCCC4(C(F)(F)F)CC4)n3)ccc2C(=O)NS(=O)(=O)c2ccccc2)C(C)(CCCCI)C1 |
| InChI | InChI=1S/C32H39F3IN5O4S/c1-3-23-21-30(2,14-7-8-18-36)40(22-23)28-25(29(42)39-46(43,44)24-9-5-4-6-10-24)11-12-26(37-28)41-19-13-27(38-41)45-20-17-31(15-16-31)32(33,34)35/h4-6,9-13,19,23H,3,7-8,14-18,20-22H2,1-2H3,(H,39,42)/t23-,30?/m0/s1 |
| InChIKey | ANYHGKVAIRBAGK-IHOKFDBFSA-N |
| XLogP | 7.10 |
| TPSA | 106.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 773.66 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|