C15H18F3N3O3S — CID 134399501
2-(1,1-dioxothian-4-yl)-3-methyl-6-(2,2,2-trifluoroethoxy)benzimidazol-5-amine (PubChem CID 134399501) has the molecular formula C15H18F3N3O3S and a molecular weight of 377.39 g/mol. Its IUPAC name is 2-(1,1-dioxothian-4-yl)-3-methyl-6-(2,2,2-trifluoroethoxy)benzimidazol-5-amine.
| Compound Name | 2-(1,1-dioxothian-4-yl)-3-methyl-6-(2,2,2-trifluoroethoxy)benzimidazol-5-amine |
|---|---|
| PubChem CID | 134399501 |
| Molecular Formula | C15H18F3N3O3S |
| Molecular Weight | 377.39 g/mol |
| Exact Mass | 377.10 |
| IUPAC Name | 2-(1,1-dioxothian-4-yl)-3-methyl-6-(2,2,2-trifluoroethoxy)benzimidazol-5-amine |
| SMILES | Cn1c(C2CCS(=O)(=O)CC2)nc2cc(OCC(F)(F)F)c(N)cc21 |
| InChI | InChI=1S/C15H18F3N3O3S/c1-21-12-6-10(19)13(24-8-15(16,17)18)7-11(12)20-14(21)9-2-4-25(22,23)5-3-9/h6-7,9H,2-5,8,19H2,1H3 |
| InChIKey | CRJCEYJUZVTHKE-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 87.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.39 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|