C10H19NO — CID 134400034
(3aR,7aS)-5-methoxy-2-methyl-1,3,3a,4,5,6,7,7a-octahydroisoindole (PubChem CID 134400034) has the molecular formula C10H19NO and a molecular weight of 169.27 g/mol. Its IUPAC name is (3aR,7aS)-5-methoxy-2-methyl-1,3,3a,4,5,6,7,7a-octahydroisoindole.
| Compound Name | (3aR,7aS)-5-methoxy-2-methyl-1,3,3a,4,5,6,7,7a-octahydroisoindole |
|---|---|
| PubChem CID | 134400034 |
| Molecular Formula | C10H19NO |
| Molecular Weight | 169.27 g/mol |
| Exact Mass | 169.15 |
| IUPAC Name | (3aR,7aS)-5-methoxy-2-methyl-1,3,3a,4,5,6,7,7a-octahydroisoindole |
| SMILES | COC1CC[C@@H]2CN(C)C[C@@H]2C1 |
| InChI | InChI=1S/C10H19NO/c1-11-6-8-3-4-10(12-2)5-9(8)7-11/h8-10H,3-7H2,1-2H3/t8-,9+,10?/m1/s1 |
| InChIKey | CKUKYIDSVCQKIU-ZDGBYWQASA-N |
| XLogP | 1.36 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.27 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |