About 7-bromo-5-but-3-enyl-4,5-dihydro-3H-azepine
7-bromo-5-but-3-enyl-4,5-dihydro-3H-azepine (PubChem CID 134400299) has the molecular formula C10H14BrN
and a molecular weight of 228.13 g/mol. Its IUPAC name is 7-bromo-5-but-3-enyl-4,5-dihydro-3H-azepine.
Molecular Properties
| Compound Name | 7-bromo-5-but-3-enyl-4,5-dihydro-3H-azepine |
| PubChem CID | 134400299 |
| Molecular Formula | C10H14BrN |
| Molecular Weight | 228.13 g/mol |
| Exact Mass | 227.03 |
| IUPAC Name | 7-bromo-5-but-3-enyl-4,5-dihydro-3H-azepine |
| SMILES | C=CCCC1C=C(Br)N=CCC1 |
| InChI | InChI=1S/C10H14BrN/c1-2-3-5-9-6-4-7-12-10(11)8-9/h2,7-9H,1,3-6H2 |
| InChIKey | JENSCAASBUMZAU-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.13 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze 7-bromo-5-but-3-enyl-4,5-dihydro-3H-azepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-bromo-5-but-3-enyl-4,5-dihydro-3H-azepine?
The IUPAC name of 7-bromo-5-but-3-enyl-4,5-dihydro-3H-azepine (CID 134400299) is 7-bromo-5-but-3-enyl-4,5-dihydro-3H-azepine.
What is the SMILES notation for 7-bromo-5-but-3-enyl-4,5-dihydro-3H-azepine?
The canonical SMILES for 7-bromo-5-but-3-enyl-4,5-dihydro-3H-azepine is C=CCCC1C=C(Br)N=CCC1.
What is the InChIKey of 7-bromo-5-but-3-enyl-4,5-dihydro-3H-azepine?
The InChIKey is JENSCAASBUMZAU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14BrN/c1-2-3-5-9-6-4-7-12-10(11)8-9/h2,7-9H,1,3-6H2.
What are the key properties of 7-bromo-5-but-3-enyl-4,5-dihydro-3H-azepine?
7-bromo-5-but-3-enyl-4,5-dihydro-3H-azepine has a molecular weight of 228.13 g/mol, XLogP of 3.67, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 7-bromo-5-but-3-enyl-4,5-dihydro-3H-azepine is sourced from PubChem (CID 134400299), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).