C10H20N2 — CID 134400309
N,2-dimethyl-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-amine (PubChem CID 134400309) has the molecular formula C10H20N2 and a molecular weight of 168.28 g/mol. Its IUPAC name is N,2-dimethyl-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-amine.
| Compound Name | N,2-dimethyl-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-amine |
|---|---|
| PubChem CID | 134400309 |
| Molecular Formula | C10H20N2 |
| Molecular Weight | 168.28 g/mol |
| Exact Mass | 168.16 |
| IUPAC Name | N,2-dimethyl-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-amine |
| SMILES | CNC1CCC2CN(C)CC2C1 |
| InChI | InChI=1S/C10H20N2/c1-11-10-4-3-8-6-12(2)7-9(8)5-10/h8-11H,3-7H2,1-2H3 |
| InChIKey | CNHXTOZSVJEWIK-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.28 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |