About methyl (3-methylcyclohexa-1,3-dien-1-yl) carbonate
methyl (3-methylcyclohexa-1,3-dien-1-yl) carbonate (PubChem CID 13440031) has the molecular formula C9H12O3
and a molecular weight of 168.19 g/mol. Its IUPAC name is methyl (3-methylcyclohexa-1,3-dien-1-yl) carbonate.
Molecular Properties
| Compound Name | methyl (3-methylcyclohexa-1,3-dien-1-yl) carbonate |
| PubChem CID | 13440031 |
| Molecular Formula | C9H12O3 |
| Molecular Weight | 168.19 g/mol |
| Exact Mass | 168.08 |
| IUPAC Name | methyl (3-methylcyclohexa-1,3-dien-1-yl) carbonate |
| SMILES | COC(=O)OC1=CC(C)=CCC1 |
| InChI | InChI=1S/C9H12O3/c1-7-4-3-5-8(6-7)12-9(10)11-2/h4,6H,3,5H2,1-2H3 |
| InChIKey | GFPLPGBDZBEJDR-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.19 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze methyl (3-methylcyclohexa-1,3-dien-1-yl) carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (3-methylcyclohexa-1,3-dien-1-yl) carbonate?
The IUPAC name of methyl (3-methylcyclohexa-1,3-dien-1-yl) carbonate (CID 13440031) is methyl (3-methylcyclohexa-1,3-dien-1-yl) carbonate.
What is the SMILES notation for methyl (3-methylcyclohexa-1,3-dien-1-yl) carbonate?
The canonical SMILES for methyl (3-methylcyclohexa-1,3-dien-1-yl) carbonate is COC(=O)OC1=CC(C)=CCC1.
What is the InChIKey of methyl (3-methylcyclohexa-1,3-dien-1-yl) carbonate?
The InChIKey is GFPLPGBDZBEJDR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12O3/c1-7-4-3-5-8(6-7)12-9(10)11-2/h4,6H,3,5H2,1-2H3.
What are the key properties of methyl (3-methylcyclohexa-1,3-dien-1-yl) carbonate?
methyl (3-methylcyclohexa-1,3-dien-1-yl) carbonate has a molecular weight of 168.19 g/mol, XLogP of 2.39, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (3-methylcyclohexa-1,3-dien-1-yl) carbonate is sourced from PubChem (CID 13440031), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).