About 2-methyl-5-(1-methyl-1,2,4-triazol-3-yl)pyrimidine
2-methyl-5-(1-methyl-1,2,4-triazol-3-yl)pyrimidine (PubChem CID 134400321) has the molecular formula C8H9N5
and a molecular weight of 175.19 g/mol. Its IUPAC name is 2-methyl-5-(1-methyl-1,2,4-triazol-3-yl)pyrimidine.
Molecular Properties
| Compound Name | 2-methyl-5-(1-methyl-1,2,4-triazol-3-yl)pyrimidine |
| PubChem CID | 134400321 |
| Molecular Formula | C8H9N5 |
| Molecular Weight | 175.19 g/mol |
| Exact Mass | 175.09 |
| IUPAC Name | 2-methyl-5-(1-methyl-1,2,4-triazol-3-yl)pyrimidine |
| SMILES | Cc1ncc(-c2ncn(C)n2)cn1 |
| InChI | InChI=1S/C8H9N5/c1-6-9-3-7(4-10-6)8-11-5-13(2)12-8/h3-5H,1-2H3 |
| InChIKey | DNBZNPQLJUXPPT-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 56.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.19 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-methyl-5-(1-methyl-1,2,4-triazol-3-yl)pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-5-(1-methyl-1,2,4-triazol-3-yl)pyrimidine?
The IUPAC name of 2-methyl-5-(1-methyl-1,2,4-triazol-3-yl)pyrimidine (CID 134400321) is 2-methyl-5-(1-methyl-1,2,4-triazol-3-yl)pyrimidine.
What is the SMILES notation for 2-methyl-5-(1-methyl-1,2,4-triazol-3-yl)pyrimidine?
The canonical SMILES for 2-methyl-5-(1-methyl-1,2,4-triazol-3-yl)pyrimidine is Cc1ncc(-c2ncn(C)n2)cn1.
What is the InChIKey of 2-methyl-5-(1-methyl-1,2,4-triazol-3-yl)pyrimidine?
The InChIKey is DNBZNPQLJUXPPT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9N5/c1-6-9-3-7(4-10-6)8-11-5-13(2)12-8/h3-5H,1-2H3.
What are the key properties of 2-methyl-5-(1-methyl-1,2,4-triazol-3-yl)pyrimidine?
2-methyl-5-(1-methyl-1,2,4-triazol-3-yl)pyrimidine has a molecular weight of 175.19 g/mol, XLogP of 0.58, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-5-(1-methyl-1,2,4-triazol-3-yl)pyrimidine is sourced from PubChem (CID 134400321), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).