About methyl [(2E)-4-methylpenta-2,4-dien-2-yl] carbonate
methyl [(2E)-4-methylpenta-2,4-dien-2-yl] carbonate (PubChem CID 13440039) has the molecular formula C8H12O3
and a molecular weight of 156.18 g/mol. Its IUPAC name is methyl [(2E)-4-methylpenta-2,4-dien-2-yl] carbonate.
Molecular Properties
| Compound Name | methyl [(2E)-4-methylpenta-2,4-dien-2-yl] carbonate |
| PubChem CID | 13440039 |
| Molecular Formula | C8H12O3 |
| Molecular Weight | 156.18 g/mol |
| Exact Mass | 156.08 |
| IUPAC Name | methyl [(2E)-4-methylpenta-2,4-dien-2-yl] carbonate |
| SMILES | C=C(C)/C=C(\C)OC(=O)OC |
| InChI | InChI=1S/C8H12O3/c1-6(2)5-7(3)11-8(9)10-4/h5H,1H2,2-4H3/b7-5+ |
| InChIKey | TXMNCIWULBFZIC-FNORWQNLSA-N |
| XLogP | 2.25 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.18 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze methyl [(2E)-4-methylpenta-2,4-dien-2-yl] carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl [(2E)-4-methylpenta-2,4-dien-2-yl] carbonate?
The IUPAC name of methyl [(2E)-4-methylpenta-2,4-dien-2-yl] carbonate (CID 13440039) is methyl [(2E)-4-methylpenta-2,4-dien-2-yl] carbonate.
What is the SMILES notation for methyl [(2E)-4-methylpenta-2,4-dien-2-yl] carbonate?
The canonical SMILES for methyl [(2E)-4-methylpenta-2,4-dien-2-yl] carbonate is C=C(C)/C=C(\C)OC(=O)OC.
What is the InChIKey of methyl [(2E)-4-methylpenta-2,4-dien-2-yl] carbonate?
The InChIKey is TXMNCIWULBFZIC-FNORWQNLSA-N. The full InChI is InChI=1S/C8H12O3/c1-6(2)5-7(3)11-8(9)10-4/h5H,1H2,2-4H3/b7-5+.
What are the key properties of methyl [(2E)-4-methylpenta-2,4-dien-2-yl] carbonate?
methyl [(2E)-4-methylpenta-2,4-dien-2-yl] carbonate has a molecular weight of 156.18 g/mol, XLogP of 2.25, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl [(2E)-4-methylpenta-2,4-dien-2-yl] carbonate is sourced from PubChem (CID 13440039), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).