C19H34S2 — CID 134401949
2,3-dimethyl-3-[5-(2,2,3-trimethylpentan-3-yl)thiophen-2-yl]pentane-2-thiol (PubChem CID 134401949) has the molecular formula C19H34S2 and a molecular weight of 326.62 g/mol. Its IUPAC name is 2,3-dimethyl-3-[5-(2,2,3-trimethylpentan-3-yl)thiophen-2-yl]pentane-2-thiol.
| Compound Name | 2,3-dimethyl-3-[5-(2,2,3-trimethylpentan-3-yl)thiophen-2-yl]pentane-2-thiol |
|---|---|
| PubChem CID | 134401949 |
| Molecular Formula | C19H34S2 |
| Molecular Weight | 326.62 g/mol |
| Exact Mass | 326.21 |
| IUPAC Name | 2,3-dimethyl-3-[5-(2,2,3-trimethylpentan-3-yl)thiophen-2-yl]pentane-2-thiol |
| SMILES | CCC(C)(c1ccc(C(C)(CC)C(C)(C)S)s1)C(C)(C)C |
| InChI | InChI=1S/C19H34S2/c1-10-18(8,16(3,4)5)14-12-13-15(21-14)19(9,11-2)17(6,7)20/h12-13,20H,10-11H2,1-9H3 |
| InChIKey | QPSORSJDYFOFPZ-UHFFFAOYSA-N |
| XLogP | 6.84 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.62 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|