C20H36S — CID 134401951
2,5-bis(2,2,3-trimethylpentan-3-yl)thiophene (PubChem CID 134401951) has the molecular formula C20H36S and a molecular weight of 308.57 g/mol. Its IUPAC name is 2,5-bis(2,2,3-trimethylpentan-3-yl)thiophene.
| Compound Name | 2,5-bis(2,2,3-trimethylpentan-3-yl)thiophene |
|---|---|
| PubChem CID | 134401951 |
| Molecular Formula | C20H36S |
| Molecular Weight | 308.57 g/mol |
| Exact Mass | 308.25 |
| IUPAC Name | 2,5-bis(2,2,3-trimethylpentan-3-yl)thiophene |
| SMILES | CCC(C)(c1ccc(C(C)(CC)C(C)(C)C)s1)C(C)(C)C |
| InChI | InChI=1S/C20H36S/c1-11-19(9,17(3,4)5)15-13-14-16(21-15)20(10,12-2)18(6,7)8/h13-14H,11-12H2,1-10H3 |
| InChIKey | FYMGWTOVOPDNIS-UHFFFAOYSA-N |
| XLogP | 7.18 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.57 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |