About 2-N'-tert-butyl-2-N'-cyclohexyl-2-N,2-N-dipropylpropane-2,2-diamine
2-N'-tert-butyl-2-N'-cyclohexyl-2-N,2-N-dipropylpropane-2,2-diamine (PubChem CID 134402323) has the molecular formula C19H40N2
and a molecular weight of 296.54 g/mol. Its IUPAC name is 2-N'-tert-butyl-2-N'-cyclohexyl-2-N,2-N-dipropylpropane-2,2-diamine.
Molecular Properties
| Compound Name | 2-N'-tert-butyl-2-N'-cyclohexyl-2-N,2-N-dipropylpropane-2,2-diamine |
| PubChem CID | 134402323 |
| Molecular Formula | C19H40N2 |
| Molecular Weight | 296.54 g/mol |
| Exact Mass | 296.32 |
| IUPAC Name | 2-N'-tert-butyl-2-N'-cyclohexyl-2-N,2-N-dipropylpropane-2,2-diamine |
| SMILES | CCCN(CCC)C(C)(C)N(C1CCCCC1)C(C)(C)C |
| InChI | InChI=1S/C19H40N2/c1-8-15-20(16-9-2)19(6,7)21(18(3,4)5)17-13-11-10-12-14-17/h17H,8-16H2,1-7H3 |
| InChIKey | WQHSCPFBPIHBPU-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 296.54 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 2-N'-tert-butyl-2-N'-cyclohexyl-2-N,2-N-dipropylpropane-2,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-N'-tert-butyl-2-N'-cyclohexyl-2-N,2-N-dipropylpropane-2,2-diamine?
The IUPAC name of 2-N'-tert-butyl-2-N'-cyclohexyl-2-N,2-N-dipropylpropane-2,2-diamine (CID 134402323) is 2-N'-tert-butyl-2-N'-cyclohexyl-2-N,2-N-dipropylpropane-2,2-diamine.
What is the SMILES notation for 2-N'-tert-butyl-2-N'-cyclohexyl-2-N,2-N-dipropylpropane-2,2-diamine?
The canonical SMILES for 2-N'-tert-butyl-2-N'-cyclohexyl-2-N,2-N-dipropylpropane-2,2-diamine is CCCN(CCC)C(C)(C)N(C1CCCCC1)C(C)(C)C.
What is the InChIKey of 2-N'-tert-butyl-2-N'-cyclohexyl-2-N,2-N-dipropylpropane-2,2-diamine?
The InChIKey is WQHSCPFBPIHBPU-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H40N2/c1-8-15-20(16-9-2)19(6,7)21(18(3,4)5)17-13-11-10-12-14-17/h17H,8-16H2,1-7H3.
What are the key properties of 2-N'-tert-butyl-2-N'-cyclohexyl-2-N,2-N-dipropylpropane-2,2-diamine?
2-N'-tert-butyl-2-N'-cyclohexyl-2-N,2-N-dipropylpropane-2,2-diamine has a molecular weight of 296.54 g/mol, XLogP of 5.28, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-N'-tert-butyl-2-N'-cyclohexyl-2-N,2-N-dipropylpropane-2,2-diamine is sourced from PubChem (CID 134402323), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).