About 3-phenyl-2,4-di(propan-2-yl)furo[2,3-b][1,4]benzothiazine
3-phenyl-2,4-di(propan-2-yl)furo[2,3-b][1,4]benzothiazine (PubChem CID 134402637) has the molecular formula C22H23NOS
and a molecular weight of 349.50 g/mol. Its IUPAC name is 3-phenyl-2,4-di(propan-2-yl)furo[2,3-b][1,4]benzothiazine.
Molecular Properties
| Compound Name | 3-phenyl-2,4-di(propan-2-yl)furo[2,3-b][1,4]benzothiazine |
| PubChem CID | 134402637 |
| Molecular Formula | C22H23NOS |
| Molecular Weight | 349.50 g/mol |
| Exact Mass | 349.15 |
| IUPAC Name | 3-phenyl-2,4-di(propan-2-yl)furo[2,3-b][1,4]benzothiazine |
| SMILES | CC(C)c1oc2c(c1-c1ccccc1)N(C(C)C)c1ccccc1S2 |
| InChI | InChI=1S/C22H23NOS/c1-14(2)21-19(16-10-6-5-7-11-16)20-22(24-21)25-18-13-9-8-12-17(18)23(20)15(3)4/h5-15H,1-4H3 |
| InChIKey | SKFFMFNDYGKSSH-UHFFFAOYSA-N |
| XLogP | 7.08 |
| TPSA | 16.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 349.50 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-phenyl-2,4-di(propan-2-yl)furo[2,3-b][1,4]benzothiazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-phenyl-2,4-di(propan-2-yl)furo[2,3-b][1,4]benzothiazine?
The IUPAC name of 3-phenyl-2,4-di(propan-2-yl)furo[2,3-b][1,4]benzothiazine (CID 134402637) is 3-phenyl-2,4-di(propan-2-yl)furo[2,3-b][1,4]benzothiazine.
What is the SMILES notation for 3-phenyl-2,4-di(propan-2-yl)furo[2,3-b][1,4]benzothiazine?
The canonical SMILES for 3-phenyl-2,4-di(propan-2-yl)furo[2,3-b][1,4]benzothiazine is CC(C)c1oc2c(c1-c1ccccc1)N(C(C)C)c1ccccc1S2.
What is the InChIKey of 3-phenyl-2,4-di(propan-2-yl)furo[2,3-b][1,4]benzothiazine?
The InChIKey is SKFFMFNDYGKSSH-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H23NOS/c1-14(2)21-19(16-10-6-5-7-11-16)20-22(24-21)25-18-13-9-8-12-17(18)23(20)15(3)4/h5-15H,1-4H3.
What are the key properties of 3-phenyl-2,4-di(propan-2-yl)furo[2,3-b][1,4]benzothiazine?
3-phenyl-2,4-di(propan-2-yl)furo[2,3-b][1,4]benzothiazine has a molecular weight of 349.50 g/mol, XLogP of 7.08, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-phenyl-2,4-di(propan-2-yl)furo[2,3-b][1,4]benzothiazine is sourced from PubChem (CID 134402637), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).