C18H17IN4 — CID 134402707
5-(6-iodo-2-pyridinyl)-2-(2,3,4,7-tetrahydro-1H-azepin-5-yl)-1H-pyrrolo[2,3-b]pyridine (PubChem CID 134402707) has the molecular formula C18H17IN4 and a molecular weight of 416.27 g/mol. Its IUPAC name is 5-(6-iodo-2-pyridinyl)-2-(2,3,4,7-tetrahydro-1H-azepin-5-yl)-1H-pyrrolo[2,3-b]pyridine.
| Compound Name | 5-(6-iodo-2-pyridinyl)-2-(2,3,4,7-tetrahydro-1H-azepin-5-yl)-1H-pyrrolo[2,3-b]pyridine |
|---|---|
| PubChem CID | 134402707 |
| Molecular Formula | C18H17IN4 |
| Molecular Weight | 416.27 g/mol |
| Exact Mass | 416.05 |
| IUPAC Name | 5-(6-iodo-2-pyridinyl)-2-(2,3,4,7-tetrahydro-1H-azepin-5-yl)-1H-pyrrolo[2,3-b]pyridine |
| SMILES | Ic1cccc(-c2cnc3[nH]c(C4=CCNCCC4)cc3c2)n1 |
| InChI | InChI=1S/C18H17IN4/c19-17-5-1-4-15(22-17)14-9-13-10-16(23-18(13)21-11-14)12-3-2-7-20-8-6-12/h1,4-6,9-11,20H,2-3,7-8H2,(H,21,23) |
| InChIKey | WIXWSKWXEKIENW-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.27 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|