C11H17N3O3 — CID 134402883
2-[(3aR,5R,6S,7R,7aR)-2-(dimethylamino)-6,7-dihydroxy-3,3a,5,6,7,7a-hexahydropyrano[3,2-b]pyrrol-5-yl]acetonitrile (PubChem CID 134402883) has the molecular formula C11H17N3O3 and a molecular weight of 239.27 g/mol. Its IUPAC name is 2-[(3aR,5R,6S,7R,7aR)-2-(dimethylamino)-6,7-dihydroxy-3,3a,5,6,7,7a-hexahydropyrano[3,2-b]pyrrol-5-yl]acetonitrile.
| Compound Name | 2-[(3aR,5R,6S,7R,7aR)-2-(dimethylamino)-6,7-dihydroxy-3,3a,5,6,7,7a-hexahydropyrano[3,2-b]pyrrol-5-yl]acetonitrile |
|---|---|
| PubChem CID | 134402883 |
| Molecular Formula | C11H17N3O3 |
| Molecular Weight | 239.27 g/mol |
| Exact Mass | 239.13 |
| IUPAC Name | 2-[(3aR,5R,6S,7R,7aR)-2-(dimethylamino)-6,7-dihydroxy-3,3a,5,6,7,7a-hexahydropyrano[3,2-b]pyrrol-5-yl]acetonitrile |
| SMILES | CN(C)C1=N[C@@H]2[C@@H](O)[C@H](O)[C@@H](CC#N)O[C@@H]2C1 |
| InChI | InChI=1S/C11H17N3O3/c1-14(2)8-5-7-9(13-8)11(16)10(15)6(17-7)3-4-12/h6-7,9-11,15-16H,3,5H2,1-2H3/t6-,7-,9+,10-,11-/m1/s1 |
| InChIKey | NHBSSAKGIWQREH-BTEFKNAISA-N |
| XLogP | -0.88 |
| TPSA | 89.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.27 |
| LogP ≤ 5 | -0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |