C14H24N4 — CID 134403191
(3S)-4-ethyl-3-methyl-1-propan-2-yl-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidine-6-carboximidamide (PubChem CID 134403191) has the molecular formula C14H24N4 and a molecular weight of 248.37 g/mol. Its IUPAC name is (3S)-4-ethyl-3-methyl-1-propan-2-yl-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidine-6-carboximidamide.
| Compound Name | (3S)-4-ethyl-3-methyl-1-propan-2-yl-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidine-6-carboximidamide |
|---|---|
| PubChem CID | 134403191 |
| Molecular Formula | C14H24N4 |
| Molecular Weight | 248.37 g/mol |
| Exact Mass | 248.20 |
| IUPAC Name | (3S)-4-ethyl-3-methyl-1-propan-2-yl-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidine-6-carboximidamide |
| SMILES | [H]/N=C(\N)C1CC2=C(CC)[C@H](C)N=C(C(C)C)N2C1 |
| InChI | InChI=1S/C14H24N4/c1-5-11-9(4)17-14(8(2)3)18-7-10(13(15)16)6-12(11)18/h8-10H,5-7H2,1-4H3,(H3,15,16)/t9-,10?/m0/s1 |
| InChIKey | UKAPCJTXKWCISJ-RGURZIINSA-N |
| XLogP | 2.36 |
| TPSA | 65.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.37 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|