C49H61N7O6 — CID 134403575
1,10-bis(4-aminobutyl)-4,7,13,16-tetrabenzyl-1,4,7,10,13-pentazacyclooctadecane-2,5,8,11,14,17-hexone (PubChem CID 134403575) has the molecular formula C49H61N7O6 and a molecular weight of 844.07 g/mol. Its IUPAC name is 1,10-bis(4-aminobutyl)-4,7,13,16-tetrabenzyl-1,4,7,10,13-pentazacyclooctadecane-2,5,8,11,14,17-hexone.
| Compound Name | 1,10-bis(4-aminobutyl)-4,7,13,16-tetrabenzyl-1,4,7,10,13-pentazacyclooctadecane-2,5,8,11,14,17-hexone |
|---|---|
| PubChem CID | 134403575 |
| Molecular Formula | C49H61N7O6 |
| Molecular Weight | 844.07 g/mol |
| Exact Mass | 843.47 |
| IUPAC Name | 1,10-bis(4-aminobutyl)-4,7,13,16-tetrabenzyl-1,4,7,10,13-pentazacyclooctadecane-2,5,8,11,14,17-hexone |
| SMILES | NCCCCN1CC(=O)C(Cc2ccccc2)CC(=O)N(Cc2ccccc2)CC(=O)N(CCCCN)CC(=O)N(Cc2ccccc2)CC(=O)N(Cc2ccccc2)CC1=O |
| InChI | InChI=1S/C49H61N7O6/c50-25-13-15-27-52-34-44(57)43(29-39-17-5-1-6-18-39)30-45(58)54(31-40-19-7-2-8-20-40)36-47(60)53(28-16-14-26-51)35-48(61)56(33-42-23-11-4-12-24-42)38-49(62)55(37-46(52)59)32-41-21-9-3-10-22-41/h1-12,17-24,43H,13-16,25-38,50-51H2 |
| InChIKey | DZTPERCNKZDGSP-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 170.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 62 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 844.07 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|