About 8-methyl-4,9-dihydro-3H-cyclohepta[b]pyridine
8-methyl-4,9-dihydro-3H-cyclohepta[b]pyridine (PubChem CID 134404601) has the molecular formula C11H13N
and a molecular weight of 159.23 g/mol. Its IUPAC name is 8-methyl-4,9-dihydro-3H-cyclohepta[b]pyridine.
Molecular Properties
| Compound Name | 8-methyl-4,9-dihydro-3H-cyclohepta[b]pyridine |
| PubChem CID | 134404601 |
| Molecular Formula | C11H13N |
| Molecular Weight | 159.23 g/mol |
| Exact Mass | 159.10 |
| IUPAC Name | 8-methyl-4,9-dihydro-3H-cyclohepta[b]pyridine |
| SMILES | CC1=CC=CC2=C(C1)N=CCC2 |
| InChI | InChI=1S/C11H13N/c1-9-4-2-5-10-6-3-7-12-11(10)8-9/h2,4-5,7H,3,6,8H2,1H3 |
| InChIKey | QWGWKTDFHCCNMS-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.23 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 8-methyl-4,9-dihydro-3H-cyclohepta[b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-methyl-4,9-dihydro-3H-cyclohepta[b]pyridine?
The IUPAC name of 8-methyl-4,9-dihydro-3H-cyclohepta[b]pyridine (CID 134404601) is 8-methyl-4,9-dihydro-3H-cyclohepta[b]pyridine.
What is the SMILES notation for 8-methyl-4,9-dihydro-3H-cyclohepta[b]pyridine?
The canonical SMILES for 8-methyl-4,9-dihydro-3H-cyclohepta[b]pyridine is CC1=CC=CC2=C(C1)N=CCC2.
What is the InChIKey of 8-methyl-4,9-dihydro-3H-cyclohepta[b]pyridine?
The InChIKey is QWGWKTDFHCCNMS-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13N/c1-9-4-2-5-10-6-3-7-12-11(10)8-9/h2,4-5,7H,3,6,8H2,1H3.
What are the key properties of 8-methyl-4,9-dihydro-3H-cyclohepta[b]pyridine?
8-methyl-4,9-dihydro-3H-cyclohepta[b]pyridine has a molecular weight of 159.23 g/mol, XLogP of 3.01, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 8-methyl-4,9-dihydro-3H-cyclohepta[b]pyridine is sourced from PubChem (CID 134404601), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).