About N-[(6R)-7-methyl-2-bicyclo[4.1.0]hepta-2,4-dienyl]ethanimine
N-[(6R)-7-methyl-2-bicyclo[4.1.0]hepta-2,4-dienyl]ethanimine (PubChem CID 134404631) has the molecular formula C10H13N
and a molecular weight of 147.22 g/mol. Its IUPAC name is N-[(6R)-7-methyl-2-bicyclo[4.1.0]hepta-2,4-dienyl]ethanimine.
Molecular Properties
| Compound Name | N-[(6R)-7-methyl-2-bicyclo[4.1.0]hepta-2,4-dienyl]ethanimine |
| PubChem CID | 134404631 |
| Molecular Formula | C10H13N |
| Molecular Weight | 147.22 g/mol |
| Exact Mass | 147.10 |
| IUPAC Name | N-[(6R)-7-methyl-2-bicyclo[4.1.0]hepta-2,4-dienyl]ethanimine |
| SMILES | C/C=N/C1=CC=C[C@@H]2C(C)C12 |
| InChI | InChI=1S/C10H13N/c1-3-11-9-6-4-5-8-7(2)10(8)9/h3-8,10H,1-2H3/b11-3+/t7?,8-,10?/m1/s1 |
| InChIKey | YWFPTZVIOASVCR-IOUSFIJCSA-N |
| XLogP | 2.41 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 147.22 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N-[(6R)-7-methyl-2-bicyclo[4.1.0]hepta-2,4-dienyl]ethanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(6R)-7-methyl-2-bicyclo[4.1.0]hepta-2,4-dienyl]ethanimine?
The IUPAC name of N-[(6R)-7-methyl-2-bicyclo[4.1.0]hepta-2,4-dienyl]ethanimine (CID 134404631) is N-[(6R)-7-methyl-2-bicyclo[4.1.0]hepta-2,4-dienyl]ethanimine.
What is the SMILES notation for N-[(6R)-7-methyl-2-bicyclo[4.1.0]hepta-2,4-dienyl]ethanimine?
The canonical SMILES for N-[(6R)-7-methyl-2-bicyclo[4.1.0]hepta-2,4-dienyl]ethanimine is C/C=N/C1=CC=C[C@@H]2C(C)C12.
What is the InChIKey of N-[(6R)-7-methyl-2-bicyclo[4.1.0]hepta-2,4-dienyl]ethanimine?
The InChIKey is YWFPTZVIOASVCR-IOUSFIJCSA-N. The full InChI is InChI=1S/C10H13N/c1-3-11-9-6-4-5-8-7(2)10(8)9/h3-8,10H,1-2H3/b11-3+/t7?,8-,10?/m1/s1.
What are the key properties of N-[(6R)-7-methyl-2-bicyclo[4.1.0]hepta-2,4-dienyl]ethanimine?
N-[(6R)-7-methyl-2-bicyclo[4.1.0]hepta-2,4-dienyl]ethanimine has a molecular weight of 147.22 g/mol, XLogP of 2.41, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(6R)-7-methyl-2-bicyclo[4.1.0]hepta-2,4-dienyl]ethanimine is sourced from PubChem (CID 134404631), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).