About 1-but-1-enyl-4-(4-ethylsulfanylcyclohexa-1,5-dien-1-yl)piperazine
1-but-1-enyl-4-(4-ethylsulfanylcyclohexa-1,5-dien-1-yl)piperazine (PubChem CID 134404659) has the molecular formula C16H26N2S
and a molecular weight of 278.47 g/mol. Its IUPAC name is 1-but-1-enyl-4-(4-ethylsulfanylcyclohexa-1,5-dien-1-yl)piperazine.
Molecular Properties
| Compound Name | 1-but-1-enyl-4-(4-ethylsulfanylcyclohexa-1,5-dien-1-yl)piperazine |
| PubChem CID | 134404659 |
| Molecular Formula | C16H26N2S |
| Molecular Weight | 278.47 g/mol |
| Exact Mass | 278.18 |
| IUPAC Name | 1-but-1-enyl-4-(4-ethylsulfanylcyclohexa-1,5-dien-1-yl)piperazine |
| SMILES | CCC=CN1CCN(C2=CCC(SCC)C=C2)CC1 |
| InChI | InChI=1S/C16H26N2S/c1-3-5-10-17-11-13-18(14-12-17)15-6-8-16(9-7-15)19-4-2/h5-8,10,16H,3-4,9,11-14H2,1-2H3 |
| InChIKey | MJHHFMQYZOBODR-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.47 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-but-1-enyl-4-(4-ethylsulfanylcyclohexa-1,5-dien-1-yl)piperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-but-1-enyl-4-(4-ethylsulfanylcyclohexa-1,5-dien-1-yl)piperazine?
The IUPAC name of 1-but-1-enyl-4-(4-ethylsulfanylcyclohexa-1,5-dien-1-yl)piperazine (CID 134404659) is 1-but-1-enyl-4-(4-ethylsulfanylcyclohexa-1,5-dien-1-yl)piperazine.
What is the SMILES notation for 1-but-1-enyl-4-(4-ethylsulfanylcyclohexa-1,5-dien-1-yl)piperazine?
The canonical SMILES for 1-but-1-enyl-4-(4-ethylsulfanylcyclohexa-1,5-dien-1-yl)piperazine is CCC=CN1CCN(C2=CCC(SCC)C=C2)CC1.
What is the InChIKey of 1-but-1-enyl-4-(4-ethylsulfanylcyclohexa-1,5-dien-1-yl)piperazine?
The InChIKey is MJHHFMQYZOBODR-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H26N2S/c1-3-5-10-17-11-13-18(14-12-17)15-6-8-16(9-7-15)19-4-2/h5-8,10,16H,3-4,9,11-14H2,1-2H3.
What are the key properties of 1-but-1-enyl-4-(4-ethylsulfanylcyclohexa-1,5-dien-1-yl)piperazine?
1-but-1-enyl-4-(4-ethylsulfanylcyclohexa-1,5-dien-1-yl)piperazine has a molecular weight of 278.47 g/mol, XLogP of 3.49, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-but-1-enyl-4-(4-ethylsulfanylcyclohexa-1,5-dien-1-yl)piperazine is sourced from PubChem (CID 134404659), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).