C33H18F8O14S4 — CID 134404688
4-[2,3,5,6-tetrafluoro-4-[2,3,5,6-tetrafluoro-4-[(2-methyl-3,6-disulfo-1,2-dihydronaphthalen-1-yl)oxy]phenyl]phenoxy]naphthalene-2,7-disulfonic acid (PubChem CID 134404688) has the molecular formula C33H18F8O14S4 and a molecular weight of 918.74 g/mol. Its IUPAC name is 4-[2,3,5,6-tetrafluoro-4-[2,3,5,6-tetrafluoro-4-[(2-methyl-3,6-disulfo-1,2-dihydronaphthalen-1-yl)oxy]phenyl]phenoxy]naphthalene-2,7-disulfonic acid.
| Compound Name | 4-[2,3,5,6-tetrafluoro-4-[2,3,5,6-tetrafluoro-4-[(2-methyl-3,6-disulfo-1,2-dihydronaphthalen-1-yl)oxy]phenyl]phenoxy]naphthalene-2,7-disulfonic acid |
|---|---|
| PubChem CID | 134404688 |
| Molecular Formula | C33H18F8O14S4 |
| Molecular Weight | 918.74 g/mol |
| Exact Mass | 917.95 |
| IUPAC Name | 4-[2,3,5,6-tetrafluoro-4-[2,3,5,6-tetrafluoro-4-[(2-methyl-3,6-disulfo-1,2-dihydronaphthalen-1-yl)oxy]phenyl]phenoxy]naphthalene-2,7-disulfonic acid |
| SMILES | CC1C(S(=O)(=O)O)=Cc2cc(S(=O)(=O)O)ccc2C1Oc1c(F)c(F)c(-c2c(F)c(F)c(Oc3cc(S(=O)(=O)O)cc4cc(S(=O)(=O)O)ccc34)c(F)c2F)c(F)c1F |
| InChI | InChI=1S/C33H18F8O14S4/c1-11-20(59(51,52)53)9-13-7-15(57(45,46)47)3-5-18(13)31(11)55-33-29(40)25(36)22(26(37)30(33)41)21-23(34)27(38)32(28(39)24(21)35)54-19-10-16(58(48,49)50)8-12-6-14(56(42,43)44)2-4-17(12)19/h2-11,31H,1H3,(H,42,43,44)(H,45,46,47)(H,48,49,50)(H,51,52,53) |
| InChIKey | RCHSHULNIUGNJB-UHFFFAOYSA-N |
| XLogP | 7.15 |
| TPSA | 235.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 918.74 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|