C16H28N2 — CID 134404815
(2E)-N'-methyl-N,6-dipropylnona-2,4,8-trienimidamide (PubChem CID 134404815) has the molecular formula C16H28N2 and a molecular weight of 248.41 g/mol. Its IUPAC name is (2E)-N'-methyl-N,6-dipropylnona-2,4,8-trienimidamide.
| Compound Name | (2E)-N'-methyl-N,6-dipropylnona-2,4,8-trienimidamide |
|---|---|
| PubChem CID | 134404815 |
| Molecular Formula | C16H28N2 |
| Molecular Weight | 248.41 g/mol |
| Exact Mass | 248.23 |
| IUPAC Name | (2E)-N'-methyl-N,6-dipropylnona-2,4,8-trienimidamide |
| SMILES | C=CCC(C=C/C=C/C(=N/C)NCCC)CCC |
| InChI | InChI=1S/C16H28N2/c1-5-10-15(11-6-2)12-8-9-13-16(17-4)18-14-7-3/h5,8-9,12-13,15H,1,6-7,10-11,14H2,2-4H3,(H,17,18)/b12-8?,13-9+ |
| InChIKey | ZEYUNYVNDOUNSB-NOQIBXEPSA-N |
| XLogP | 4.12 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.41 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|