About [5-[1-(4,4-difluoropiperidin-1-yl)-2-(methylamino)ethyl]-1,3-thiazol-2-yl]methanol
[5-[1-(4,4-difluoropiperidin-1-yl)-2-(methylamino)ethyl]-1,3-thiazol-2-yl]methanol (PubChem CID 134404920) has the molecular formula C12H19F2N3OS
and a molecular weight of 291.37 g/mol. Its IUPAC name is [5-[1-(4,4-difluoropiperidin-1-yl)-2-(methylamino)ethyl]-1,3-thiazol-2-yl]methanol.
Molecular Properties
| Compound Name | [5-[1-(4,4-difluoropiperidin-1-yl)-2-(methylamino)ethyl]-1,3-thiazol-2-yl]methanol |
| PubChem CID | 134404920 |
| Molecular Formula | C12H19F2N3OS |
| Molecular Weight | 291.37 g/mol |
| Exact Mass | 291.12 |
| IUPAC Name | [5-[1-(4,4-difluoropiperidin-1-yl)-2-(methylamino)ethyl]-1,3-thiazol-2-yl]methanol |
| SMILES | CNCC(c1cnc(CO)s1)N1CCC(F)(F)CC1 |
| InChI | InChI=1S/C12H19F2N3OS/c1-15-6-9(10-7-16-11(8-18)19-10)17-4-2-12(13,14)3-5-17/h7,9,15,18H,2-6,8H2,1H3 |
| InChIKey | JFLIBDWEQLVOKB-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 48.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.37 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [5-[1-(4,4-difluoropiperidin-1-yl)-2-(methylamino)ethyl]-1,3-thiazol-2-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-[1-(4,4-difluoropiperidin-1-yl)-2-(methylamino)ethyl]-1,3-thiazol-2-yl]methanol?
The IUPAC name of [5-[1-(4,4-difluoropiperidin-1-yl)-2-(methylamino)ethyl]-1,3-thiazol-2-yl]methanol (CID 134404920) is [5-[1-(4,4-difluoropiperidin-1-yl)-2-(methylamino)ethyl]-1,3-thiazol-2-yl]methanol.
What is the SMILES notation for [5-[1-(4,4-difluoropiperidin-1-yl)-2-(methylamino)ethyl]-1,3-thiazol-2-yl]methanol?
The canonical SMILES for [5-[1-(4,4-difluoropiperidin-1-yl)-2-(methylamino)ethyl]-1,3-thiazol-2-yl]methanol is CNCC(c1cnc(CO)s1)N1CCC(F)(F)CC1.
What is the InChIKey of [5-[1-(4,4-difluoropiperidin-1-yl)-2-(methylamino)ethyl]-1,3-thiazol-2-yl]methanol?
The InChIKey is JFLIBDWEQLVOKB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19F2N3OS/c1-15-6-9(10-7-16-11(8-18)19-10)17-4-2-12(13,14)3-5-17/h7,9,15,18H,2-6,8H2,1H3.
What are the key properties of [5-[1-(4,4-difluoropiperidin-1-yl)-2-(methylamino)ethyl]-1,3-thiazol-2-yl]methanol?
[5-[1-(4,4-difluoropiperidin-1-yl)-2-(methylamino)ethyl]-1,3-thiazol-2-yl]methanol has a molecular weight of 291.37 g/mol, XLogP of 1.63, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [5-[1-(4,4-difluoropiperidin-1-yl)-2-(methylamino)ethyl]-1,3-thiazol-2-yl]methanol is sourced from PubChem (CID 134404920), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).