About 2-(2-cyclobutyl-1,3-thiazol-5-yl)-2-(4,4-difluoropiperidin-1-yl)-N-methylethanamine
2-(2-cyclobutyl-1,3-thiazol-5-yl)-2-(4,4-difluoropiperidin-1-yl)-N-methylethanamine (PubChem CID 134404948) has the molecular formula C15H23F2N3S
and a molecular weight of 315.43 g/mol. Its IUPAC name is 2-(2-cyclobutyl-1,3-thiazol-5-yl)-2-(4,4-difluoropiperidin-1-yl)-N-methylethanamine.
Molecular Properties
| Compound Name | 2-(2-cyclobutyl-1,3-thiazol-5-yl)-2-(4,4-difluoropiperidin-1-yl)-N-methylethanamine |
| PubChem CID | 134404948 |
| Molecular Formula | C15H23F2N3S |
| Molecular Weight | 315.43 g/mol |
| Exact Mass | 315.16 |
| IUPAC Name | 2-(2-cyclobutyl-1,3-thiazol-5-yl)-2-(4,4-difluoropiperidin-1-yl)-N-methylethanamine |
| SMILES | CNCC(c1cnc(C2CCC2)s1)N1CCC(F)(F)CC1 |
| InChI | InChI=1S/C15H23F2N3S/c1-18-9-12(20-7-5-15(16,17)6-8-20)13-10-19-14(21-13)11-3-2-4-11/h10-12,18H,2-9H2,1H3 |
| InChIKey | YGFGIKVNFPESND-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.43 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(2-cyclobutyl-1,3-thiazol-5-yl)-2-(4,4-difluoropiperidin-1-yl)-N-methylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-cyclobutyl-1,3-thiazol-5-yl)-2-(4,4-difluoropiperidin-1-yl)-N-methylethanamine?
The IUPAC name of 2-(2-cyclobutyl-1,3-thiazol-5-yl)-2-(4,4-difluoropiperidin-1-yl)-N-methylethanamine (CID 134404948) is 2-(2-cyclobutyl-1,3-thiazol-5-yl)-2-(4,4-difluoropiperidin-1-yl)-N-methylethanamine.
What is the SMILES notation for 2-(2-cyclobutyl-1,3-thiazol-5-yl)-2-(4,4-difluoropiperidin-1-yl)-N-methylethanamine?
The canonical SMILES for 2-(2-cyclobutyl-1,3-thiazol-5-yl)-2-(4,4-difluoropiperidin-1-yl)-N-methylethanamine is CNCC(c1cnc(C2CCC2)s1)N1CCC(F)(F)CC1.
What is the InChIKey of 2-(2-cyclobutyl-1,3-thiazol-5-yl)-2-(4,4-difluoropiperidin-1-yl)-N-methylethanamine?
The InChIKey is YGFGIKVNFPESND-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H23F2N3S/c1-18-9-12(20-7-5-15(16,17)6-8-20)13-10-19-14(21-13)11-3-2-4-11/h10-12,18H,2-9H2,1H3.
What are the key properties of 2-(2-cyclobutyl-1,3-thiazol-5-yl)-2-(4,4-difluoropiperidin-1-yl)-N-methylethanamine?
2-(2-cyclobutyl-1,3-thiazol-5-yl)-2-(4,4-difluoropiperidin-1-yl)-N-methylethanamine has a molecular weight of 315.43 g/mol, XLogP of 3.40, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-cyclobutyl-1,3-thiazol-5-yl)-2-(4,4-difluoropiperidin-1-yl)-N-methylethanamine is sourced from PubChem (CID 134404948), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).