C20H32FNO2 — CID 134405162
1-[(2E,4Z)-3-ethoxy-6-fluorohepta-2,4,6-trienyl]-3-methyl-4-[(E)-pent-2-en-2-yl]oxypiperidine (PubChem CID 134405162) has the molecular formula C20H32FNO2 and a molecular weight of 337.48 g/mol. Its IUPAC name is 1-[(2E,4Z)-3-ethoxy-6-fluorohepta-2,4,6-trienyl]-3-methyl-4-[(E)-pent-2-en-2-yl]oxypiperidine.
| Compound Name | 1-[(2E,4Z)-3-ethoxy-6-fluorohepta-2,4,6-trienyl]-3-methyl-4-[(E)-pent-2-en-2-yl]oxypiperidine |
|---|---|
| PubChem CID | 134405162 |
| Molecular Formula | C20H32FNO2 |
| Molecular Weight | 337.48 g/mol |
| Exact Mass | 337.24 |
| IUPAC Name | 1-[(2E,4Z)-3-ethoxy-6-fluorohepta-2,4,6-trienyl]-3-methyl-4-[(E)-pent-2-en-2-yl]oxypiperidine |
| SMILES | C=C(F)/C=C\C(=C/CN1CCC(O/C(C)=C/CC)C(C)C1)OCC |
| InChI | InChI=1S/C20H32FNO2/c1-6-8-18(5)24-20-12-14-22(15-16(20)3)13-11-19(23-7-2)10-9-17(4)21/h8-11,16,20H,4,6-7,12-15H2,1-3,5H3/b10-9-,18-8+,19-11+ |
| InChIKey | FUGAUKQKWMVUAK-XMKCYJDCSA-N |
| XLogP | 4.99 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.48 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|