About 4-[(E,3R)-3-hydroxy-3-(2-methylphenoxy)prop-1-enyl]phenol
4-[(E,3R)-3-hydroxy-3-(2-methylphenoxy)prop-1-enyl]phenol (PubChem CID 134405203) has the molecular formula C16H16O3
and a molecular weight of 256.30 g/mol. Its IUPAC name is 4-[(E,3R)-3-hydroxy-3-(2-methylphenoxy)prop-1-enyl]phenol.
Molecular Properties
| Compound Name | 4-[(E,3R)-3-hydroxy-3-(2-methylphenoxy)prop-1-enyl]phenol |
| PubChem CID | 134405203 |
| Molecular Formula | C16H16O3 |
| Molecular Weight | 256.30 g/mol |
| Exact Mass | 256.11 |
| IUPAC Name | 4-[(E,3R)-3-hydroxy-3-(2-methylphenoxy)prop-1-enyl]phenol |
| SMILES | Cc1ccccc1O[C@@H](O)/C=C/c1ccc(O)cc1 |
| InChI | InChI=1S/C16H16O3/c1-12-4-2-3-5-15(12)19-16(18)11-8-13-6-9-14(17)10-7-13/h2-11,16-18H,1H3/b11-8+/t16-/m1/s1 |
| InChIKey | ZYWIHCSRPSABSO-YCABEKBOSA-N |
| XLogP | 3.11 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.30 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 4-[(E,3R)-3-hydroxy-3-(2-methylphenoxy)prop-1-enyl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(E,3R)-3-hydroxy-3-(2-methylphenoxy)prop-1-enyl]phenol?
The IUPAC name of 4-[(E,3R)-3-hydroxy-3-(2-methylphenoxy)prop-1-enyl]phenol (CID 134405203) is 4-[(E,3R)-3-hydroxy-3-(2-methylphenoxy)prop-1-enyl]phenol.
What is the SMILES notation for 4-[(E,3R)-3-hydroxy-3-(2-methylphenoxy)prop-1-enyl]phenol?
The canonical SMILES for 4-[(E,3R)-3-hydroxy-3-(2-methylphenoxy)prop-1-enyl]phenol is Cc1ccccc1O[C@@H](O)/C=C/c1ccc(O)cc1.
What is the InChIKey of 4-[(E,3R)-3-hydroxy-3-(2-methylphenoxy)prop-1-enyl]phenol?
The InChIKey is ZYWIHCSRPSABSO-YCABEKBOSA-N. The full InChI is InChI=1S/C16H16O3/c1-12-4-2-3-5-15(12)19-16(18)11-8-13-6-9-14(17)10-7-13/h2-11,16-18H,1H3/b11-8+/t16-/m1/s1.
What are the key properties of 4-[(E,3R)-3-hydroxy-3-(2-methylphenoxy)prop-1-enyl]phenol?
4-[(E,3R)-3-hydroxy-3-(2-methylphenoxy)prop-1-enyl]phenol has a molecular weight of 256.30 g/mol, XLogP of 3.11, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(E,3R)-3-hydroxy-3-(2-methylphenoxy)prop-1-enyl]phenol is sourced from PubChem (CID 134405203), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).