About pentafluoro-(4-methylcyclohexa-2,4-dien-1-yl)-λ6-sulfane
pentafluoro-(4-methylcyclohexa-2,4-dien-1-yl)-λ6-sulfane (PubChem CID 134405226) has the molecular formula C7H9F5S
and a molecular weight of 220.21 g/mol. Its IUPAC name is pentafluoro-(4-methylcyclohexa-2,4-dien-1-yl)-λ6-sulfane.
Molecular Properties
| Compound Name | pentafluoro-(4-methylcyclohexa-2,4-dien-1-yl)-λ6-sulfane |
| PubChem CID | 134405226 |
| Molecular Formula | C7H9F5S |
| Molecular Weight | 220.21 g/mol |
| Exact Mass | 220.03 |
| IUPAC Name | pentafluoro-(4-methylcyclohexa-2,4-dien-1-yl)-λ6-sulfane |
| SMILES | CC1=CCC(S(F)(F)(F)(F)F)C=C1 |
| InChI | InChI=1S/C7H9F5S/c1-6-2-4-7(5-3-6)13(8,9,10,11)12/h2-4,7H,5H2,1H3 |
| InChIKey | BYYPSSZYWVUHKT-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.21 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze pentafluoro-(4-methylcyclohexa-2,4-dien-1-yl)-λ6-sulfane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pentafluoro-(4-methylcyclohexa-2,4-dien-1-yl)-λ6-sulfane?
The IUPAC name of pentafluoro-(4-methylcyclohexa-2,4-dien-1-yl)-λ6-sulfane (CID 134405226) is pentafluoro-(4-methylcyclohexa-2,4-dien-1-yl)-λ6-sulfane.
What is the SMILES notation for pentafluoro-(4-methylcyclohexa-2,4-dien-1-yl)-λ6-sulfane?
The canonical SMILES for pentafluoro-(4-methylcyclohexa-2,4-dien-1-yl)-λ6-sulfane is CC1=CCC(S(F)(F)(F)(F)F)C=C1.
What is the InChIKey of pentafluoro-(4-methylcyclohexa-2,4-dien-1-yl)-λ6-sulfane?
The InChIKey is BYYPSSZYWVUHKT-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9F5S/c1-6-2-4-7(5-3-6)13(8,9,10,11)12/h2-4,7H,5H2,1H3.
What are the key properties of pentafluoro-(4-methylcyclohexa-2,4-dien-1-yl)-λ6-sulfane?
pentafluoro-(4-methylcyclohexa-2,4-dien-1-yl)-λ6-sulfane has a molecular weight of 220.21 g/mol, XLogP of 4.56, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for pentafluoro-(4-methylcyclohexa-2,4-dien-1-yl)-λ6-sulfane is sourced from PubChem (CID 134405226), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).