C18H20NO3PS — CID 134405419
8-(4-formylphenyl)phosphanyl-6,6-dimethyl-2,3,5,7-tetrahydro-1,4-benzothiazine-3-carboxylic acid (PubChem CID 134405419) has the molecular formula C18H20NO3PS and a molecular weight of 361.40 g/mol. Its IUPAC name is 8-(4-formylphenyl)phosphanyl-6,6-dimethyl-2,3,5,7-tetrahydro-1,4-benzothiazine-3-carboxylic acid.
| Compound Name | 8-(4-formylphenyl)phosphanyl-6,6-dimethyl-2,3,5,7-tetrahydro-1,4-benzothiazine-3-carboxylic acid |
|---|---|
| PubChem CID | 134405419 |
| Molecular Formula | C18H20NO3PS |
| Molecular Weight | 361.40 g/mol |
| Exact Mass | 361.09 |
| IUPAC Name | 8-(4-formylphenyl)phosphanyl-6,6-dimethyl-2,3,5,7-tetrahydro-1,4-benzothiazine-3-carboxylic acid |
| SMILES | CC1(C)CC2=NC(C(=O)O)CSC2=C(Pc2ccc(C=O)cc2)C1 |
| InChI | InChI=1S/C18H20NO3PS/c1-18(2)7-13-16(24-10-14(19-13)17(21)22)15(8-18)23-12-5-3-11(9-20)4-6-12/h3-6,9,14,23H,7-8,10H2,1-2H3,(H,21,22) |
| InChIKey | YAYNUXCHZIFSKY-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 66.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.40 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|